Search

SMILES identifier of lithium bis(trimethylsilyl)amide

Input interpretation

lithium bis(trimethylsilyl)amide | SMILES identifier
lithium bis(trimethylsilyl)amide | SMILES identifier

Result

[Li+].C[Si](C)(C)[N-][Si](C)(C)C
[Li+].C[Si](C)(C)[N-][Si](C)(C)C

Random Queries

IUPAC sodium borate decahydrate vs magnesium
vapor pressure of deuterated methylcyclohexane (D14)
CAS number of lithium polysilicate
formula of ammonium-d 4deuteroxide vs manganese(III) fluoride
(melting point of 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluorododecyl acrylate)/(freezing point of 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluorododecyl acrylate)
formula of sodium phosphonate pentahydrate
chemical types of pyrophosphoric acid vs oxalic acid
group of barium vs oxygen
discovery year of hoelite
molar mass of gallium(III) fluoride trihydrate