Input interpretation
silver(I) sulfadiazine
Chemical names and formulas
formula | C_10H_9AgN_4O_2S name | silver(I) sulfadiazine IUPAC name | silver (4-aminophenyl)sulfonyl-(2-pyrimidinyl)azanide alternate names | silver 2-pyrimidyl-sulfanilyl-azanide | silver (4-aminophenyl)sulfonyl-pyrimidin-2-yl-azanide | silver (4-aminophenyl)sulfonyl-pyrimidin-2-ylazanide mass fractions | Ag (silver) 30.2% | C (carbon) 33.6% | H (hydrogen) 2.54% | N (nitrogen) 15.7% | O (oxygen) 8.96% | S (sulfur) 8.98%
Structure diagram
Structure diagram
vertex count | 18 edge count | 20 Schultz index | 2284 Wiener index | 536 Hosoya index | 2808 Balaban index | 1.837
Basic properties
molar mass | 357.14 g/mol phase | solid (at STP) melting point | 285 °C
Units
Hydrophobicity and permeability properties
predicted LogP hydrophobicity | 0.19 predicted LogS | -1.66
Basic drug properties
approval status | approved | small molecule drug categories | local anti-infective agent | antibacterial agent | topical antibiotic dosage forms | topical: cream
brand names | dermazin | flamazine | SSD (1% silver sulfadiazine cream USP) | sildaflo | silvadene | thermazene
Chemical identifiers
CAS number | 22199-08-2 PubChem CID number | 452254 PubChem SID number | 24871745 SMILES identifier | C1=CN=C(N=C1)[N-]S(=O)(=O)C2=CC=C(C=C2)N.[Ag+] InChI identifier | InChI=1/C10H9N4O2S.Ag/c11-8-2-4-9(5-3-8)17(15, 16)14-10-12-6-1-7-13-10;/h1-7H, 11H2;/q-1;+1 InChI key | UEJSSZHHYBHCEL-UHFFFAOYAS RTECS number | WP1950000 MDL number | MFCD00072101