Search

tetraethylammonium perchlorate

Input interpretation

tetraethylammonium perchlorate
tetraethylammonium perchlorate

Chemical names and formulas

formula | C_8H_20ClNO_4 name | tetraethylammonium perchlorate IUPAC name | tetraethylazanium perchlorate alternate names | ammonium, tetraethyl-, perchlorate | ethanaminium, N, N, N-triethyl-, perchlorate | tetraethylammonium perchlorate(dry) [Forbidden] mass fractions | C (carbon) 41.8% | Cl (chlorine) 15.4% | H (hydrogen) 8.78% | N (nitrogen) 6.1% | O (oxygen) 27.9%
formula | C_8H_20ClNO_4 name | tetraethylammonium perchlorate IUPAC name | tetraethylazanium perchlorate alternate names | ammonium, tetraethyl-, perchlorate | ethanaminium, N, N, N-triethyl-, perchlorate | tetraethylammonium perchlorate(dry) [Forbidden] mass fractions | C (carbon) 41.8% | Cl (chlorine) 15.4% | H (hydrogen) 8.78% | N (nitrogen) 6.1% | O (oxygen) 27.9%

Structure diagram

Structure diagram
Structure diagram
| bond counts | bond lengths | bond energies | 4 bonds | 1.5 Å | 346 kJ/mol | 20 bonds | 1.1 Å | 411 kJ/mol | 4 bonds | 1.5 Å | 305 kJ/mol | 3 bonds | | | 1 bond | |
| bond counts | bond lengths | bond energies | 4 bonds | 1.5 Å | 346 kJ/mol | 20 bonds | 1.1 Å | 411 kJ/mol | 4 bonds | 1.5 Å | 305 kJ/mol | 3 bonds | | | 1 bond | |

3D structure

3D structure
3D structure

Basic properties

molar mass | 229.7 g/mol phase | solid (at STP) melting point | 300 °C density | 1.3 g/cm^3 solubility in water | slightly soluble
molar mass | 229.7 g/mol phase | solid (at STP) melting point | 300 °C density | 1.3 g/cm^3 solubility in water | slightly soluble

Units

Solid properties (at STP)

density | 1.3 g/cm^3
density | 1.3 g/cm^3

Units

Chemical identifiers

CAS number | 2567-83-1 Beilstein number | 3638093 PubChem CID number | 2734932 SMILES identifier | CC[N+](CC)(CC)CC.[O-]Cl(=O)(=O)=O InChI identifier | InChI=1/C8H20N.ClHO4/c1-5-9(6-2, 7-3)8-4;2-1(3, 4)5/h5-8H2, 1-4H3;(H, 2, 3, 4, 5)/q+1;/p-1/fC8H20N.ClO4/qm;-1 EU number | 219-904-3 RTECS number | BS7366000 NSC number | 220061
CAS number | 2567-83-1 Beilstein number | 3638093 PubChem CID number | 2734932 SMILES identifier | CC[N+](CC)(CC)CC.[O-]Cl(=O)(=O)=O InChI identifier | InChI=1/C8H20N.ClHO4/c1-5-9(6-2, 7-3)8-4;2-1(3, 4)5/h5-8H2, 1-4H3;(H, 2, 3, 4, 5)/q+1;/p-1/fC8H20N.ClO4/qm;-1 EU number | 219-904-3 RTECS number | BS7366000 NSC number | 220061

NFPA label

NFPA label
NFPA label
NFPA health rating | 3 NFPA fire rating | 0 NFPA reactivity rating | 1
NFPA health rating | 3 NFPA fire rating | 0 NFPA reactivity rating | 1

Safety properties

flash point | 344 °C
flash point | 344 °C
DOT hazard class | 5.1 DOT numbers | 1479
DOT hazard class | 5.1 DOT numbers | 1479

Random Queries

ion class of bromide anion vs phosphide anion
melting point of fluoboric acid vs copper(II) trifluoromethanesulfonate
NFPA label of manganese(II) perchlorate hexahydrate
name of antimony pentachloride vs barium strontium tungsten oxide
alternate names of vanadium(V) oxychloride vs appex
sodium hydride vs zinc
molar mass of ammonia vs water
carbon, hydrogen, molybdenum
InChI identifier of sodium tetrachloroplatinate(II) hydrate
molar heat of fusion of nickel