Search

SMILES identifier of ethylene vs phenoxathiin

Input interpretation

ethylene phenoxathiin | SMILES identifier
ethylene phenoxathiin | SMILES identifier

Results

ethylene | C=C phenoxathiin | C1=CC=C2C(=C1)OC3=CC=CC=C3S2
ethylene | C=C phenoxathiin | C1=CC=C2C(=C1)OC3=CC=CC=C3S2

Random Queries

melting point of ruthenium vs indium
lower explosive limit of strong acids
formula string of carbon tetrachloride
alternate names of cadmium cation vs zirconium(IV) cation
cleavage of anyuiite vs danbaite
iodine, hydrogen
total number of valence electrons of strontium cation vs bromide anion
xenon pentafluoride hexafluororuthenate
density of L-serine vs L-valine
S + Ni = NiS