Search

name of 2-methoxyphenylzinc iodide vs 3-(trifluoromethyl)phenylboronic acid

Input interpretation

2-methoxyphenylzinc iodide | 3-(trifluoromethyl)phenylboronic acid
2-methoxyphenylzinc iodide | 3-(trifluoromethyl)phenylboronic acid

Chemical names and formulas

 | 2-methoxyphenylzinc iodide | 3-(trifluoromethyl)phenylboronic acid formula | CH_3OC_6H_4ZnI | CF_3C_6H_4B(OH)_2 Hill formula | C_7H_7IOZn | C_7H_6BF_3O_2 name | 2-methoxyphenylzinc iodide | 3-(trifluoromethyl)phenylboronic acid IUPAC name | iodozinc; methoxybenzene | [3-(trifluoromethyl)phenyl]boronic acid alternate names | iodozinc; methoxybenzene | 3-(trifluoromethyl)benzeneboronic acid | [3-(trifluoromethyl)phenyl]boronic acid mass fractions | C (carbon) 28.1% | H (hydrogen) 2.36% | I (iodine) 42.4% | O (oxygen) 5.34% | Zn (zinc) 21.8% | B (boron) 5.69% | C (carbon) 44.3% | F (fluorine) 30% | H (hydrogen) 3.18% | O (oxygen) 16.8%
| 2-methoxyphenylzinc iodide | 3-(trifluoromethyl)phenylboronic acid formula | CH_3OC_6H_4ZnI | CF_3C_6H_4B(OH)_2 Hill formula | C_7H_7IOZn | C_7H_6BF_3O_2 name | 2-methoxyphenylzinc iodide | 3-(trifluoromethyl)phenylboronic acid IUPAC name | iodozinc; methoxybenzene | [3-(trifluoromethyl)phenyl]boronic acid alternate names | iodozinc; methoxybenzene | 3-(trifluoromethyl)benzeneboronic acid | [3-(trifluoromethyl)phenyl]boronic acid mass fractions | C (carbon) 28.1% | H (hydrogen) 2.36% | I (iodine) 42.4% | O (oxygen) 5.34% | Zn (zinc) 21.8% | B (boron) 5.69% | C (carbon) 44.3% | F (fluorine) 30% | H (hydrogen) 3.18% | O (oxygen) 16.8%

Structure diagrams

Structure diagrams
Structure diagrams

Basic properties

 | 2-methoxyphenylzinc iodide | 3-(trifluoromethyl)phenylboronic acid molar mass | 299.42 g/mol | 189.93 g/mol phase | | solid (at STP) melting point | | 164.5 °C density | 0.996 g/cm^3 |
| 2-methoxyphenylzinc iodide | 3-(trifluoromethyl)phenylboronic acid molar mass | 299.42 g/mol | 189.93 g/mol phase | | solid (at STP) melting point | | 164.5 °C density | 0.996 g/cm^3 |

Units

Chemical identifiers

 | 2-methoxyphenylzinc iodide | 3-(trifluoromethyl)phenylboronic acid CAS number | 282727-20-2 | 1423-26-3 Beilstein number | | 6084746 PubChem CID number | 5191287 | 2734388 PubChem SID number | 24873229 | 24867063 SMILES identifier | COC1=CC=CC=[C-]1.[Zn+]I | B(C1=CC(=CC=C1)C(F)(F)F)(O)O InChI identifier | InChI=1/C7H7O.HI.Zn/c1-8-7-5-3-2-4-6-7;;/h2-5H, 1H3;1H;/q-1;;+2/p-1/fC7H7O.I.Zn/h;1h;/qm;-1;m/rC7H7O.IZn/c1-8-7-5-3-2-4-6-7;1-2/h2-5H, 1H3;/q-1;+1 | InChI=1/C7H6BF3O2/c9-7(10, 11)5-2-1-3-6(4-5)8(12)13/h1-4, 12-13H MDL number | MFCD01311442 | MFCD00151854
| 2-methoxyphenylzinc iodide | 3-(trifluoromethyl)phenylboronic acid CAS number | 282727-20-2 | 1423-26-3 Beilstein number | | 6084746 PubChem CID number | 5191287 | 2734388 PubChem SID number | 24873229 | 24867063 SMILES identifier | COC1=CC=CC=[C-]1.[Zn+]I | B(C1=CC(=CC=C1)C(F)(F)F)(O)O InChI identifier | InChI=1/C7H7O.HI.Zn/c1-8-7-5-3-2-4-6-7;;/h2-5H, 1H3;1H;/q-1;;+2/p-1/fC7H7O.I.Zn/h;1h;/qm;-1;m/rC7H7O.IZn/c1-8-7-5-3-2-4-6-7;1-2/h2-5H, 1H3;/q-1;+1 | InChI=1/C7H6BF3O2/c9-7(10, 11)5-2-1-3-6(4-5)8(12)13/h1-4, 12-13H MDL number | MFCD01311442 | MFCD00151854