N-methoxy-N-methyl-2-(phenylsulfinyl)acetamide

N-methoxy-N-methyl-2-(phenylsulfinyl)acetamide

formula | C_6H_5SOCH_2CON(OCH_3)CH_3 Hill formula | C_10H_13NO_3S name | N-methoxy-N-methyl-2-(phenylsulfinyl)acetamide IUPAC name | N-methoxy-N-methyl-2-phenylsulfinylacetamide alternate names | N-methoxy-N-methyl-2-phenylsulfinyl-acetamide | N-methoxy-N-methyl-2-phenylsulfinylacetamide | N-methoxy-N-methyl-2-phenylsulfinyl-ethanamide mass fractions | C (carbon) 52.8% | H (hydrogen) 5.77% | N (nitrogen) 6.16% | O (oxygen) 21.1% | S (sulfur) 14.1%

Draw the Lewis structure of N-methoxy-N-methyl-2-(phenylsulfinyl)acetamide. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), oxygen (n_O, val = 6), and sulfur (n_S, val = 6) atoms: 10 n_C, val + 13 n_H, val + n_N, val + 3 n_O, val + n_S, val = 82 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), oxygen (n_O, full = 8), and sulfur (n_S, full = 8): 10 n_C, full + 13 n_H, full + n_N, full + 3 n_O, full + n_S, full = 146 Subtracting these two numbers shows that 146 - 82 = 64 bonding electrons are needed. Each bond has two electrons, so in addition to the 28 bonds already present in the diagram we expect to add 4 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Add 4 bonds by pairing electrons between adjacent highlighted atoms. Additionally, atoms with large electronegativities can minimize their formal charge by forcing atoms with smaller electronegativities on period 3 or higher to expand their valence shells. The electronegativities of the atoms are 2.20 (hydrogen), 2.55 (carbon), 2.58 (sulfur), 3.04 (nitrogen), and 3.44 (oxygen). Because the electronegativity of sulfur is smaller than the electronegativity of oxygen, expand the valence shell of sulfur to 4 bonds. Therefore we add a total of 5 bonds to the diagram. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |

3D structure

molar mass | 227.28 g/mol density | 1.23 g/cm^3

CAS number | 212180-20-6 PubChem CID number | 3593278 PubChem SID number | 24873443 SMILES identifier | CN(C(=O)CS(=O)C1=CC=CC=C1)OC InChI identifier | InChI=1/C10H13NO3S/c1-11(14-2)10(12)8-15(13)9-6-4-3-5-7-9/h3-7H, 8H2, 1-2H3 MDL number | MFCD02093648