Input interpretation
oxazepam-d 5solution
Chemical names and formulas
formula | C_6D_5CHCH_2CHOHCONHC_6H_3Cl Hill formula | C_16H_9D_5ClNO_2 name | oxazepam-d 5solution IUPAC name | 7-chloro-3-hydroxy-5-(2, 3, 4, 5, 6-pentadeuteriophenyl)-1, 3, 4, 5-tetrahydro-1-benzazepin-2-one alternate names | 7-chloro-3-hydroxy-5-(2, 3, 4, 5, 6-pentadeuteriophenyl)-1, 3, 4, 5-tetrahydro-1-benzazepin-2-one mass fractions | Cl (chlorine) 0.121% | O (oxygen) 0.109% | N (nitrogen) 0.0478% | C (carbon) 0.656% | H (hydrogen) 0.0654%
Lewis structure
Draw the Lewis structure of oxazepam-d 5solution. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: 16 n_C, val + n_Cl, val + 14 n_H, val + n_N, val + 2 n_O, val = 102 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): 16 n_C, full + n_Cl, full + 14 n_H, full + n_N, full + 2 n_O, full = 188 Subtracting these two numbers shows that 188 - 102 = 86 bonding electrons are needed. Each bond has two electrons, so in addition to the 36 bonds already present in the diagram add 7 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 7 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom rings are aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 292.77 g/mol
Units
Non-standard atom properties
H-2 | 5
Chemical identifiers
CAS number | 65854-78-6 PubChem CID number | 16217595 PubChem SID number | 24882048 SMILES identifier | C1C(C2=C(C=CC(=C2)Cl)NC(=O)C1O)C3=CC=CC=C3 InChI identifier | InChI=1/C16H14ClNO2/c17-11-6-7-14-13(8-11)12(9-15(19)16(20)18-14)10-4-2-1-3-5-10/h1-8, 12, 15, 19H, 9H2, (H, 18, 20)/i1D, 2D, 3D, 4D, 5D/f/h18H MDL number | MFCD00070369