Input interpretation
2, 2, 3, 3, 3-pentafluoropropyl acrylate
Chemical names and formulas
formula | H_2C=CHCO_2CH_2CF_2CF_3 Hill formula | C_6H_5F_5O_2 name | 2, 2, 3, 3, 3-pentafluoropropyl acrylate IUPAC name | prop-2-enoic acid 2, 2, 3, 3, 3-pentafluoropropyl ester alternate names | 1H, 1H-pentafluoropropyl acrylate | 2, 2, 3, 3, 3-pentafluoropropyl prop-2-enoate | 2-propenoic acid, 2, 2, 3, 3, 3-pentafluoropropyl ester | acrylic acid 2, 2, 3, 3, 3-pentafluoropropyl ester mass fractions | C (carbon) 35.3% | F (fluorine) 46.5% | H (hydrogen) 2.47% | O (oxygen) 15.7%
Lewis structure
Draw the Lewis structure of 2, 2, 3, 3, 3-pentafluoropropyl acrylate. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 6 n_C, val + 5 n_F, val + 5 n_H, val + 2 n_O, val = 76 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 6 n_C, full + 5 n_F, full + 5 n_H, full + 2 n_O, full = 114 Subtracting these two numbers shows that 114 - 76 = 38 bonding electrons are needed. Each bond has two electrons, so in addition to the 17 bonds already present in the diagram add 2 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 2 bonds by pairing electrons between adjacent highlighted atoms: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 204.1 g/mol phase | liquid (at STP) boiling point | 50 °C (measured at 13330 Pa) density | 1.32 g/cm^3
Units
Liquid properties (at STP)
density | 1.32 g/cm^3 refractive index | 1.336
Units
Chemical identifiers
CAS number | 356-86-5 PubChem CID number | 67744 PubChem SID number | 24870692 SMILES identifier | C=CC(=O)OCC(C(F)(F)F)(F)F InChI identifier | InChI=1/C6H5F5O2/c1-2-4(12)13-3-5(7, 8)6(9, 10)11/h2H, 1, 3H2 MDL number | MFCD00039257
Safety properties
flash point | 22.78 °C
DOT numbers | 3272