Search

formula string of 2,4-dicyclohexyl-2-methylpentane

Input interpretation

2, 4-dicyclohexyl-2-methylpentane | formula string
2, 4-dicyclohexyl-2-methylpentane | formula string

Result

C6H11CH(CH3)CH2C(CH3)2C6H11
C6H11CH(CH3)CH2C(CH3)2C6H11

Random Queries

melting point of strontium hydrogenphosphate
melting point of sodium nitrite-15 N vs protactinium
molar mass of holmium(III) oxide vs nickel cobalt oxide
density of sodium peroxide vs arsenic pentafluoride
alternate names of magnesium zincate functional group
IUPAC name of halogenated compounds
MDL number of iodomethane-13 C
molar mass of manganese(IV) ions
name of trisodium phosphate
formula of cadmium cyanide vs lead(II) chromate