name of 4-(bromomethyl)phenylboronic acid

4-(bromomethyl)phenylboronic acid

formula | BrCH_2(C_6H_4)B(OH)_2 Hill formula | C_7H_8BBrO_2 name | 4-(bromomethyl)phenylboronic acid IUPAC name | [4-(bromomethyl)phenyl]boronic acid alternate names | [4-(bromomethyl)phenyl]boronic acid mass fractions | B (boron) 5.03% | Br (bromine) 37.2% | C (carbon) 39.1% | H (hydrogen) 3.75% | O (oxygen) 14.9%

Draw the Lewis structure of 4-(bromomethyl)phenylboronic acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the boron (n_B, val = 3), bromine (n_Br, val = 7), carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: n_B, val + n_Br, val + 7 n_C, val + 8 n_H, val + 2 n_O, val = 58 Calculate the number of electrons needed to completely fill the valence shells for boron (n_B, full = 6), bromine (n_Br, full = 8), carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): n_B, full + n_Br, full + 7 n_C, full + 8 n_H, full + 2 n_O, full = 102 Subtracting these two numbers shows that 102 - 58 = 44 bonding electrons are needed. Each bond has two electrons, so in addition to the 19 bonds already present in the diagram add 3 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 3 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |

molar mass | 214.85 g/mol phase | solid (at STP) melting point | 175 °C

CAS number | 68162-47-0 PubChem CID number | 2735593 PubChem SID number | 24885493 SMILES identifier | B(C1=CC=C(C=C1)CBr)(O)O InChI identifier | InChI=1/C7H8BBrO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4, 10-11H, 5H2 MDL number | MFCD01318113