Search

InChI identifier of phosphorus allotropes

Input interpretation

phosphorus allotropes | InChI identifier
phosphorus allotropes | InChI identifier

Results

black phosphorus | InChI=1/P red phosphorus | InChI=1/P diphosphorus | InChI=1S/P2/c1-2 white phosphorus | InChI=1S/P4/c1-2-3(1)4(1)2
black phosphorus | InChI=1/P red phosphorus | InChI=1/P diphosphorus | InChI=1S/P2/c1-2 white phosphorus | InChI=1S/P4/c1-2-3(1)4(1)2
phosphorus allotropes | InChI identifier | InChI=1/P | InChI=1/P | InChI=1S/P2/c1-2 | InChI=1S/P4/c1-2-3(1)4(1)2 ()
phosphorus allotropes | InChI identifier | InChI=1/P | InChI=1/P | InChI=1S/P2/c1-2 | InChI=1S/P4/c1-2-3(1)4(1)2 ()

Random Queries

molar mass of alpha,alpha,4-tribromoacetophenone vs 6-undecanone
density of 1,4-butanediol dimethacrylate
chemical uses of copper iron oxide
IUPAC name of iodic acid
IUPAC name of chromic acid vs potassium fluoride
DOT numbers of sodium chromate vs scandium antimonide
name of phosgene-13 c
chemical types cyclopropanemethanol
(name of vanadium(V) cation)/(net ionic charge of vanadium(V) cation)
O2 + C6H13OH = H2O + CO2