Search

name of boron trifluoride phosphoric acid complex

Input interpretation

boron trifluoride phosphoric acid complex
boron trifluoride phosphoric acid complex

Chemical names and formulas

formula | BF_3·H_3PO_4 Hill formula | BF_3H_3O_4P name | boron trifluoride phosphoric acid complex IUPAC name | phosphoric acid; trifluoroborane alternate names | phosphoric acid; trifluoroborane mass fractions | B (boron) 6.52% | F (fluorine) 34.4% | H (hydrogen) 1.82% | O (oxygen) 38.6% | P (phosphorus) 18.7%
formula | BF_3·H_3PO_4 Hill formula | BF_3H_3O_4P name | boron trifluoride phosphoric acid complex IUPAC name | phosphoric acid; trifluoroborane alternate names | phosphoric acid; trifluoroborane mass fractions | B (boron) 6.52% | F (fluorine) 34.4% | H (hydrogen) 1.82% | O (oxygen) 38.6% | P (phosphorus) 18.7%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 165.8 g/mol phase | liquid (at STP) boiling point | 147 °C density | 1.84 g/cm^3
molar mass | 165.8 g/mol phase | liquid (at STP) boiling point | 147 °C density | 1.84 g/cm^3

Units

Liquid properties (at STP)

density | 1.84 g/cm^3
density | 1.84 g/cm^3

Units

Chemical identifiers

CAS number | 13669-76-6 PubChem CID number | 11480637 PubChem SID number | 24850574 SMILES identifier | B(F)(F)F.OP(=O)(O)O InChI identifier | InChI=1/BF3.H3O4P/c2-1(3)4;1-5(2, 3)4/h;(H3, 1, 2, 3, 4)/f/h;1-3H MDL number | MFCD00040371
CAS number | 13669-76-6 PubChem CID number | 11480637 PubChem SID number | 24850574 SMILES identifier | B(F)(F)F.OP(=O)(O)O InChI identifier | InChI=1/BF3.H3O4P/c2-1(3)4;1-5(2, 3)4/h;(H3, 1, 2, 3, 4)/f/h;1-3H MDL number | MFCD00040371

Safety properties

flash point | 96.11 °C
flash point | 96.11 °C