Input interpretation
(S)-(-)-2-(tert-butoxycarbonylamino)-3-cyclohexyl-1-propanol
Chemical names and formulas
![formula | C_6H_11CH_2CH[NHCO_2C(CH_3)_3]CH_2OH Hill formula | C_14H_27NO_3 name | (S)-(-)-2-(tert-butoxycarbonylamino)-3-cyclohexyl-1-propanol IUPAC name | N-[(1S)-1-(cyclohexylmethyl)-2-hydroxyethyl]carbamic acid tert-butyl ester alternate names | N-[(1S)-1-(cyclohexylmethyl)-2-hydroxy-ethyl]carbamic acid tert-butyl ester | tert-butyl N-[(1S)-1-(cyclohexylmethyl)-2-hydroxy-ethyl]carbamate | tert-butyl N-[(2S)-1-cyclohexyl-3-hydroxy-propan-2-yl]carbamate | tert-butyl N-[(2S)-1-cyclohexyl-3-hydroxypropan-2-yl]carbamate mass fractions | C (carbon) 65.3% | H (hydrogen) 10.6% | N (nitrogen) 5.44% | O (oxygen) 18.6%](../image_source/472a8c72ec532cdc765dc854554169cd.png)
formula | C_6H_11CH_2CH[NHCO_2C(CH_3)_3]CH_2OH Hill formula | C_14H_27NO_3 name | (S)-(-)-2-(tert-butoxycarbonylamino)-3-cyclohexyl-1-propanol IUPAC name | N-[(1S)-1-(cyclohexylmethyl)-2-hydroxyethyl]carbamic acid tert-butyl ester alternate names | N-[(1S)-1-(cyclohexylmethyl)-2-hydroxy-ethyl]carbamic acid tert-butyl ester | tert-butyl N-[(1S)-1-(cyclohexylmethyl)-2-hydroxy-ethyl]carbamate | tert-butyl N-[(2S)-1-cyclohexyl-3-hydroxy-propan-2-yl]carbamate | tert-butyl N-[(2S)-1-cyclohexyl-3-hydroxypropan-2-yl]carbamate mass fractions | C (carbon) 65.3% | H (hydrogen) 10.6% | N (nitrogen) 5.44% | O (oxygen) 18.6%
Lewis structure
Draw the Lewis structure of (S)-(-)-2-(tert-butoxycarbonylamino)-3-cyclohexyl-1-propanol. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: 14 n_C, val + 27 n_H, val + n_N, val + 3 n_O, val = 106 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): 14 n_C, full + 27 n_H, full + n_N, full + 3 n_O, full = 198 Subtracting these two numbers shows that 198 - 106 = 92 bonding electrons are needed. Each bond has two electrons, so in addition to the 45 bonds already present in the diagram add 1 bond. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 1 bond by pairing electrons between adjacent highlighted atoms: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 257.37 g/mol phase | liquid (at STP) boiling point | 214 °C density | 1.126 g/cm^3
Units
Liquid properties (at STP)
density | 1.126 g/cm^3 refractive index | 1.464
Units
Chemical identifiers
CAS number | 103322-56-1 PubChem CID number | 11043405 PubChem SID number | 24866395 SMILES identifier | CC(C)(C)OC(=O)NC(CC1CCCCC1)CO InChI identifier | InChI=1/C14H27NO3/c1-14(2, 3)18-13(17)15-12(10-16)9-11-7-5-4-6-8-11/h11-12, 16H, 4-10H2, 1-3H3, (H, 15, 17)/t12-/m0/s1/f/h15H MDL number | MFCD00076899
Safety properties
flash point | 58.33 °C