Search

creatine-phosphate

Input interpretation

creatine-phosphate
creatine-phosphate

Chemical names and formulas

formula | C_4H_10N_3O_5P_1 Hill formula | C_4H_10N_3O_5P name | creatine-phosphate alternate names | N-phosphocreatine | neo-ton | phosphorylcreatine | phosphocreatine | P-creatine | creatine-P mass fractions | C (carbon) 21% | H (hydrogen) 5.28% | N (nitrogen) 18.3% | O (oxygen) 41.9% | P (phosphorus) 13.5%
formula | C_4H_10N_3O_5P_1 Hill formula | C_4H_10N_3O_5P name | creatine-phosphate alternate names | N-phosphocreatine | neo-ton | phosphorylcreatine | phosphocreatine | P-creatine | creatine-P mass fractions | C (carbon) 21% | H (hydrogen) 5.28% | N (nitrogen) 18.3% | O (oxygen) 41.9% | P (phosphorus) 13.5%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 229.13 g/mol
molar mass | 229.13 g/mol

Units

Chemical identifiers

CAS number | 67-07-2 SMILES identifier | CN(CC(=O)O)C(=N)N.OP(=O)(O)O
CAS number | 67-07-2 SMILES identifier | CN(CC(=O)O)C(=N)N.OP(=O)(O)O

Random Queries

name of beryllium carbide
relative molecular mass of potassium hexaiodoplatinate(IV)
name of oxygen difluoride vs propadiene
lattice schematic of lead
discovery year of flerovium vs lead
iron(III) bromide vs 5-bromo-2-methoxybenzylzinc chloride
atomic spectrum of hydrogen
nuclear radius of gaseous elements
name of ytterbium(III) cation vs erbium(III) cation
atomic number of nobelium vs thorium