Search

SMILES identifier of sodium erythorbate vs 5-methoxy-2-benzimidazolethiol

Input interpretation

sodium erythorbate 5-methoxy-2-benzimidazolethiol | SMILES identifier
sodium erythorbate 5-methoxy-2-benzimidazolethiol | SMILES identifier

Results

sodium erythorbate | C(C(C1C(=O)C(=C(O1)[O-])O)O)O.[Na+] 5-methoxy-2-benzimidazolethiol | COC1=CC2=C(C=C1)NC(=S)N2
sodium erythorbate | C(C(C1C(=O)C(=C(O1)[O-])O)O)O.[Na+] 5-methoxy-2-benzimidazolethiol | COC1=CC2=C(C=C1)NC(=S)N2

Random Queries

CAS number of ruthenium
decay modes of Pu-236
predicted LogP hydrophobicities of polar solvents
molar mass of thiosulfate anion
melting point of potassium chromate vs arsenic(III) telluride
name of europium(III) cation vs iron(II) cation
melting point of 1-butanol
group of chlorine
formula bis(triphenylphosphoranylidene)ammonium chloride
names of halides