Search

SMILES identifier of sodium erythorbate vs 5-methoxy-2-benzimidazolethiol

Input interpretation

sodium erythorbate 5-methoxy-2-benzimidazolethiol | SMILES identifier
sodium erythorbate 5-methoxy-2-benzimidazolethiol | SMILES identifier

Results

sodium erythorbate | C(C(C1C(=O)C(=C(O1)[O-])O)O)O.[Na+] 5-methoxy-2-benzimidazolethiol | COC1=CC2=C(C=C1)NC(=S)N2
sodium erythorbate | C(C(C1C(=O)C(=C(O1)[O-])O)O)O.[Na+] 5-methoxy-2-benzimidazolethiol | COC1=CC2=C(C=C1)NC(=S)N2

Random Queries

lanthanum(III) nitrate hexahydrate vs vanadium(V) sulfate
polonide(2-) anion
C + SiO2 + Ca3(PO4) = CO + P + CaSiO3
chemical types indium(I) chloride
sulfates
atomic mass of Sn-122 vs Yb-176
color of stepanovite
O2 + CuS = SO2 + Cu2O
name of strontium selenate
name of mercuric oxide vs beryllium sulfate tetrahydrate