Input interpretation

vanadium pentoxide
Chemical names and formulas

formula | V_2O_5 Hill formula | O_5V_2 name | vanadium pentoxide alternate names | vanadic acid anhydride | vanadic anhydride | vanadium pentaoxide | vanadium(V) oxide mass fractions | O (oxygen) 44% | V (vanadium) 56%
Structure diagram

Structure diagram

vertex count | 7 edge count | 6 Schultz index | 176 Wiener index | 48 Hosoya index | 15 Balaban index | 2.953
Basic properties

molar mass | 181.88 g/mol phase | solid (at STP) melting point | 690 °C boiling point | 1750 °C density | 3.35 g/cm^3
Units
Solid properties (at STP)

density | 3.35 g/cm^3
Units
Thermodynamic properties

specific heat capacity c_p | solid | 0.7021 J/(g K) molar heat capacity c_p | solid | 127.7 J/(mol K) specific free energy of formation Δ_fG° | solid | -7.805 kJ/g molar free energy of formation Δ_fG° | solid | -1420 kJ/mol specific heat of formation Δ_fH° | solid | -8.525 kJ/g molar heat of formation Δ_fH° | solid | -1551 kJ/mol molar heat of fusion | 64 kJ/mol | specific heat of fusion | 0.35 kJ/g | (at STP)
Chemical identifiers
O[V](=O)=O InChI identifier | InChI=1/5O.2V/rO5V2/c1-6(2)5-7(3)4 RTECS number | YW2450000 MDL number | MFCD00011457](../image_source/bf76d436f9350e4875f4485073658a24.png)
CAS number | 1314-62-1 PubChem CID number | 14814 PubChem SID number | 24852295 SMILES identifier | O=[V](=O)O[V](=O)=O InChI identifier | InChI=1/5O.2V/rO5V2/c1-6(2)5-7(3)4 RTECS number | YW2450000 MDL number | MFCD00011457
NFPA label

NFPA label

NFPA health rating | 3 NFPA fire rating | 0 NFPA reactivity rating | 0
Toxicity properties

lethal dosage | 10 mg/kg (oral dose for rats)

probable lethal dose for man | 4 mL (milliliters) RTECS classes | tumorigen