Input interpretation
iodoform
Chemical names and formulas
formula | CHI_3 name | iodoform alternate names | methane, triiodo- | triiodomethane | triiodomethane (iodoform) mass fractions | C (carbon) 3.05% | H (hydrogen) 0.256% | I (iodine) 96.7%
Lewis structure
Draw the Lewis structure of iodoform. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and iodine (n_I, val = 7) atoms: n_C, val + n_H, val + 3 n_I, val = 26 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and iodine (n_I, full = 8): n_C, full + n_H, full + 3 n_I, full = 34 Subtracting these two numbers shows that 34 - 26 = 8 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 4 bonds and hence 8 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 26 - 8 = 18 electrons left to draw: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 393.732 g/mol phase | solid (at STP) melting point | 119.5 °C boiling point | 218 °C density | 4.008 g/cm^3
Units
Solid properties (at STP)
density | 4.008 g/cm^3 vapor pressure | 0.034 mmHg (at 25 °C) refractive index | 1.786
Units
Thermodynamic properties
specific heat capacity c_p | gas | 0.1905 J/(g K) molar heat capacity c_p | gas | 75 J/(mol K) specific heat of formation Δ_fH° | gas | 0.6375 kJ/g | solid | -0.46 kJ/g molar heat of formation Δ_fH° | gas | 251 kJ/mol | solid | -181.1 kJ/mol molar heat of vaporization | 46.8 kJ/mol | specific heat of vaporization | 0.119 kJ/g | molar heat of combustion | 678 kJ/mol | specific heat of combustion | 1.72 kJ/g | molar heat of fusion | 16.44 kJ/mol | specific heat of fusion | 0.04175 kJ/g | critical temperature | 858 K | critical pressure | 5.63 MPa | (at STP)
Chemical identifiers
CAS number | 75-47-8 Beilstein number | 1697010 PubChem CID number | 6374 PubChem SID number | 24846919 SMILES identifier | C(I)(I)I InChI identifier | InChI=1/CHI3/c2-1(3)4/h1H RTECS number | PB7000000 MDL number | MFCD00001069
NFPA label
NFPA label
Safety properties
flash point | 204 °C
Toxicity properties
short-term exposure limit | 20 mg/m^3
Units
