Search

name of lead(II) phthalocyanine

Input interpretation

lead(II) phthalocyanine
lead(II) phthalocyanine

Chemical names and formulas

formula | C_32H_16N_8Pb name | lead(II) phthalocyanine alternate names | phthalocyanine lead salt mass fractions | C (carbon) 53.4% | H (hydrogen) 2.24% | N (nitrogen) 15.6% | Pb (lead) 28.8%
formula | C_32H_16N_8Pb name | lead(II) phthalocyanine alternate names | phthalocyanine lead salt mass fractions | C (carbon) 53.4% | H (hydrogen) 2.24% | N (nitrogen) 15.6% | Pb (lead) 28.8%

Structure diagram

Structure diagram
Structure diagram
vertex count | 41 edge count | 50 Schultz index | 21376 Wiener index | 4424 Hosoya index | (data not available) Balaban index | 1.104
vertex count | 41 edge count | 50 Schultz index | 21376 Wiener index | 4424 Hosoya index | (data not available) Balaban index | 1.104

Basic properties

molar mass | 719.7 g/mol
molar mass | 719.7 g/mol

Units

Chemical identifiers

CAS number | 15187-16-3 PubChem CID number | 636278 PubChem SID number | 24863670 SMILES identifier | C1=CC=C2C(=C1)C3=NC4=C5C=CC=CC5=C6N4[Pb]N7C(=NC2=N3)C8=CC=CC=C8C7=NC9=NC(=N6)C1=CC=CC=C19 MDL number | MFCD00053951
CAS number | 15187-16-3 PubChem CID number | 636278 PubChem SID number | 24863670 SMILES identifier | C1=CC=C2C(=C1)C3=NC4=C5C=CC=CC5=C6N4[Pb]N7C(=NC2=N3)C8=CC=CC=C8C7=NC9=NC(=N6)C1=CC=CC=C19 MDL number | MFCD00053951

Random Queries

CAS number of hydrogen peroxide
HCl + Mg(OH)2 = H2O + MgCl2
DOT numbers of selenium trioxide
total number of protons of tin(IV) cation
net ionic charge of terbium(III) cation
molar heat of vaporization of 1,4-dimethylbenzene
formula of chromous chloride
molar mass of vanadyl dichloride vs aluminum fluoride
vertex types of lead(II) cation vs chlorate anion
molar mass of thiocyanate anion vs nitrate anion