Input interpretation
ammonium sulfate
Chemical names and formulas
formula | (NH_4)_2SO_4 Hill formula | H_8N_2O_4S name | ammonium sulfate alternate names | actamaster | diammonium sulfate | diazanium sulfate | dolamin | mascagnite | sulfuric acid, diammonium salt mass fractions | H (hydrogen) 6.1% | N (nitrogen) 21.2% | O (oxygen) 48.4% | S (sulfur) 24.3%
Structure diagram
Structure diagram
Basic properties
molar mass | 132.1 g/mol phase | solid (at STP) melting point | 280 °C density | 1.77 g/cm^3
Units
Solid properties (at STP)
density | 1.77 g/cm^3
Units
Thermodynamic properties
specific heat capacity c_p | solid | 1.419 J/(g K) molar heat capacity c_p | solid | 187.5 J/(mol K) specific free energy of formation Δ_fG° | solid | -6.824 kJ/g molar free energy of formation Δ_fG° | solid | -901.7 kJ/mol specific heat of formation Δ_fH° | solid | -8.937 kJ/g molar heat of formation Δ_fH° | solid | -1181 kJ/mol (at STP)
Chemical identifiers
CAS number | 7783-20-2 SMILES identifier | [NH4+].[NH4+].O=S(=O)([O-])[O-] RTECS number | BS4500000 MDL number | MFCD00003391
NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0
Safety properties
flash point | 235 °C
Toxicity properties
odor | odorless
RTECS classes | agricultural chemical and pesticide | mutagen | human data
Ion equivalents
(SO_4)^(2-) (sulfate anion) | 1