Search

1-[(trimethylsilyl)ethynyl]-3-(trifluoromethyl)benzene

Input interpretation

1-[(trimethylsilyl)ethynyl]-3-(trifluoromethyl)benzene
1-[(trimethylsilyl)ethynyl]-3-(trifluoromethyl)benzene

Chemical names and formulas

formula | CF_3C_6H_4C congruent CSi(CH_3)_3 Hill formula | C_12H_13F_3Si name | 1-[(trimethylsilyl)ethynyl]-3-(trifluoromethyl)benzene IUPAC name | trimethyl-[2-[3-(trifluoromethyl)phenyl]ethynyl]silane alternate names | 1-(3'-trifluoromethylphenyl)-2-(trimethylsilyl)acetylene | trimethyl-[2-[3-(trifluoromethyl)phenyl]ethynyl]silane mass fractions | C (carbon) 59.5% | F (fluorine) 23.5% | H (hydrogen) 5.41% | Si (silicon) 11.6%
formula | CF_3C_6H_4C congruent CSi(CH_3)_3 Hill formula | C_12H_13F_3Si name | 1-[(trimethylsilyl)ethynyl]-3-(trifluoromethyl)benzene IUPAC name | trimethyl-[2-[3-(trifluoromethyl)phenyl]ethynyl]silane alternate names | 1-(3'-trifluoromethylphenyl)-2-(trimethylsilyl)acetylene | trimethyl-[2-[3-(trifluoromethyl)phenyl]ethynyl]silane mass fractions | C (carbon) 59.5% | F (fluorine) 23.5% | H (hydrogen) 5.41% | Si (silicon) 11.6%

Lewis structure

Draw the Lewis structure of 1-[(trimethylsilyl)ethynyl]-3-(trifluoromethyl)benzene. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds:  Count the total valence electrons of the carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), and silicon (n_Si, val = 4) atoms: 12 n_C, val + 3 n_F, val + 13 n_H, val + n_Si, val = 86 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), and silicon (n_Si, full = 8): 12 n_C, full + 3 n_F, full + 13 n_H, full + n_Si, full = 154 Subtracting these two numbers shows that 154 - 86 = 68 bonding electrons are needed. Each bond has two electrons, so in addition to the 29 bonds already present in the diagram add 5 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom:  Fill in the 5 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: |   |
Draw the Lewis structure of 1-[(trimethylsilyl)ethynyl]-3-(trifluoromethyl)benzene. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), and silicon (n_Si, val = 4) atoms: 12 n_C, val + 3 n_F, val + 13 n_H, val + n_Si, val = 86 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), and silicon (n_Si, full = 8): 12 n_C, full + 3 n_F, full + 13 n_H, full + n_Si, full = 154 Subtracting these two numbers shows that 154 - 86 = 68 bonding electrons are needed. Each bond has two electrons, so in addition to the 29 bonds already present in the diagram add 5 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 5 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |

3D structure

3D structure
3D structure

Basic properties

molar mass | 242.32 g/mol phase | liquid (at STP) boiling point | 51 °C (measured at 66.65 Pa) density | 1.036 g/cm^3
molar mass | 242.32 g/mol phase | liquid (at STP) boiling point | 51 °C (measured at 66.65 Pa) density | 1.036 g/cm^3

Units

Liquid properties (at STP)

density | 1.036 g/cm^3 refractive index | 1.476
density | 1.036 g/cm^3 refractive index | 1.476

Units

Chemical identifiers

CAS number | 40230-93-1 PubChem CID number | 4281885 PubChem SID number | 24880052 SMILES identifier | C[Si](C)(C)C#CC1=CC(=CC=C1)C(F)(F)F InChI identifier | InChI=1/C12H13F3Si/c1-16(2, 3)8-7-10-5-4-6-11(9-10)12(13, 14)15/h4-6, 9H, 1-3H3 MDL number | MFCD03701551
CAS number | 40230-93-1 PubChem CID number | 4281885 PubChem SID number | 24880052 SMILES identifier | C[Si](C)(C)C#CC1=CC(=CC=C1)C(F)(F)F InChI identifier | InChI=1/C12H13F3Si/c1-16(2, 3)8-7-10-5-4-6-11(9-10)12(13, 14)15/h4-6, 9H, 1-3H3 MDL number | MFCD03701551

Safety properties

flash point | 85 °C
flash point | 85 °C