Input interpretation
![1, 3-bis(dimethylamino)-2-propanol](../image_source/036caf95c24eccfee3bf6cd6f8038f55.png)
1, 3-bis(dimethylamino)-2-propanol
Chemical names and formulas
![formula | (CH_3)_2NCH_2CH(OH)CH_2N(CH_3)_2 Hill formula | C_7H_18N_2O name | 1, 3-bis(dimethylamino)-2-propanol IUPAC name | 1, 3-bis(dimethylamino)propan-2-ol alternate names | 1, 3-bis(dimethylamino)-2-hydroxypropane | 1, 3-bis(dimethylamino)isopropanol | 1, 3-bis(dimethylamino)propan-2-ol | N, N, N', N'-tetramethyl-1, 3-diamino-2-propanol | N, N, N', N'-tetramethyl-2-hydroxy-1, 3-diaminopropane mass fractions | C (carbon) 57.5% | H (hydrogen) 12.4% | N (nitrogen) 19.2% | O (oxygen) 10.9%](../image_source/4c61f386620023fa9d7413f4ece48a78.png)
formula | (CH_3)_2NCH_2CH(OH)CH_2N(CH_3)_2 Hill formula | C_7H_18N_2O name | 1, 3-bis(dimethylamino)-2-propanol IUPAC name | 1, 3-bis(dimethylamino)propan-2-ol alternate names | 1, 3-bis(dimethylamino)-2-hydroxypropane | 1, 3-bis(dimethylamino)isopropanol | 1, 3-bis(dimethylamino)propan-2-ol | N, N, N', N'-tetramethyl-1, 3-diamino-2-propanol | N, N, N', N'-tetramethyl-2-hydroxy-1, 3-diaminopropane mass fractions | C (carbon) 57.5% | H (hydrogen) 12.4% | N (nitrogen) 19.2% | O (oxygen) 10.9%
Lewis structure
![Draw the Lewis structure of 1, 3-bis(dimethylamino)-2-propanol. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: 7 n_C, val + 18 n_H, val + 2 n_N, val + n_O, val = 62 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): 7 n_C, full + 18 n_H, full + 2 n_N, full + n_O, full = 116 Subtracting these two numbers shows that 116 - 62 = 54 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 27 bonds and hence 54 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 62 - 54 = 8 electrons left to draw: Answer: | |](../image_source/c7a657e7c3204fe0722c8040df87df18.png)
Draw the Lewis structure of 1, 3-bis(dimethylamino)-2-propanol. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), nitrogen (n_N, val = 5), and oxygen (n_O, val = 6) atoms: 7 n_C, val + 18 n_H, val + 2 n_N, val + n_O, val = 62 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), nitrogen (n_N, full = 8), and oxygen (n_O, full = 8): 7 n_C, full + 18 n_H, full + 2 n_N, full + n_O, full = 116 Subtracting these two numbers shows that 116 - 62 = 54 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 27 bonds and hence 54 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 62 - 54 = 8 electrons left to draw: Answer: | |
3D structure
![3D structure](../image_source/3fbd5471ab38c52bf1d5588f9e3142c1.png)
3D structure
Basic properties
![molar mass | 146.23 g/mol phase | liquid (at STP) boiling point | 178 °C density | 0.897 g/cm^3 solubility in water | very soluble](../image_source/d56ded45eacaef436648e0550388ba8a.png)
molar mass | 146.23 g/mol phase | liquid (at STP) boiling point | 178 °C density | 0.897 g/cm^3 solubility in water | very soluble
Units
Liquid properties (at STP)
![density | 0.897 g/cm^3 refractive index | 1.442](../image_source/ce045f98495e431077e1149a11f409c7.png)
density | 0.897 g/cm^3 refractive index | 1.442
Units
Chemical identifiers
![CAS number | 5966-51-8 PubChem CID number | 22263 PubChem SID number | 24891765 SMILES identifier | CN(C)CC(CN(C)C)O InChI identifier | InChI=1/C7H18N2O/c1-8(2)5-7(10)6-9(3)4/h7, 10H, 5-6H2, 1-4H3 RTECS number | UA7370000 MDL number | MFCD00008332](../image_source/f57e10da1797e4b51d2c95c752117f29.png)
CAS number | 5966-51-8 PubChem CID number | 22263 PubChem SID number | 24891765 SMILES identifier | CN(C)CC(CN(C)C)O InChI identifier | InChI=1/C7H18N2O/c1-8(2)5-7(10)6-9(3)4/h7, 10H, 5-6H2, 1-4H3 RTECS number | UA7370000 MDL number | MFCD00008332
Safety properties
![flash point | 110 °C](../image_source/4c72d24123b2a6c8e7eb069c98889f2f.png)
flash point | 110 °C
Toxicity properties
![RTECS classes | other](../image_source/ab7c82a8b6390194853f8839d547c921.png)
RTECS classes | other