Search

InChI identifier of 4-iodo-D-phenylalanine

Input interpretation

4-iodo-D-phenylalanine | InChI identifier
4-iodo-D-phenylalanine | InChI identifier

Result

InChI=1/C9H10INO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4, 8H, 5, 11H2, (H, 12, 13)/f/h12H
InChI=1/C9H10INO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4, 8H, 5, 11H2, (H, 12, 13)/f/h12H

Random Queries

HBr + HClO3 = H2O + Cl2 + Br2
discovery year of aguilarite
member of group 8 ions
BaCO3 = CO2 + BaO
alternate names of oxoantimony(III) cation
DOT numbers of rubidium perchlorate vs potassium perchlorate
HNO3 + Fe = H2O + NO + FeNO3
molar mass of sodium phosphonate pentahydrate vs copper(II) hexafluorosilicate tetrahydrate
molar mass of borane isoamylsulfide complex
freezing point of monofluorophosphoric acid