Search

InChI identifier of chromium(II) oxalate

Input interpretation

chromium(II) oxalate | InChI identifier
chromium(II) oxalate | InChI identifier

Result

InChI=1/C2H2O4.Cr/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Cr/q-2;m
InChI=1/C2H2O4.Cr/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Cr/q-2;m

Random Queries

DOT strontium selenide
calcium chlorite vs 3-chlorobenzylzinc chloride
topaz vs corundum vs amber vs birnessite vs gmelinite-Na
molar mass of tantalum(III) cation
name of silicon monoxide vs aluminum oxide
net ionic charge of osmium(VI) cation vs chromium(III) cation
IUPAC name of hydrogen chloride vs carbon monoxide
molecular mass of halogenated compounds
common compound names of gadolinium
element types of 1,1'-(4-chlorobutylidene)bis(4-fluorobenzene)