Search

InChI identifier of chromium(II) oxalate

Input interpretation

chromium(II) oxalate | InChI identifier
chromium(II) oxalate | InChI identifier

Result

InChI=1/C2H2O4.Cr/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Cr/q-2;m
InChI=1/C2H2O4.Cr/c3-1(4)2(5)6;/h(H, 3, 4)(H, 5, 6);/q;+2/p-2/fC2O4.Cr/q-2;m

Random Queries

molar mass of calcium fluorophosphate vs magnesium phosphate hydrate
HNO3 + CuS = H2O + S + NO2 + Cu(NO3)2
melting point of ethylene dichloride
alternate names of hexabromostannate(IV) anion vs ferricyanide anion
1,2-propanediol dibenzoate
atomic number of fermium vs mendelevium
IUPAC name of titanium tetrachloride
CAS number of catalysts
color of magnesium vs aluminum
ions of calcium hydride