Input interpretation
niobium pentoxide
Chemical names and formulas
formula | Nb_2O_5 name | niobium pentoxide alternate names | columbium pentoxide | diniobium pentaoxide | niobium oxide | niobium(V) oxide mass fractions | Nb (niobium) 69.9% | O (oxygen) 30.1%
Structure diagram
Structure diagram
vertex count | 7 edge count | 6 Schultz index | 176 Wiener index | 48 Hosoya index | 15 Balaban index | 2.953
Basic properties
molar mass | 265.808 g/mol phase | solid (at STP) melting point | 1496 °C density | 4.47 g/cm^3
Units
Solid properties (at STP)
density | 4.47 g/cm^3 refractive index | 1.7
Units
Thermodynamic properties
specific heat capacity c_p | solid | 0.497 J/(g K) molar heat capacity c_p | solid | 132.1 J/(mol K) specific free energy of formation Δ_fG° | solid | -6.644 kJ/g molar free energy of formation Δ_fG° | solid | -1766 kJ/mol specific heat of formation Δ_fH° | solid | -7.146 kJ/g molar heat of formation Δ_fH° | solid | -1900 kJ/mol molar heat of vaporization | 535.7 kJ/mol | specific heat of vaporization | 2.015 kJ/g | molar heat of fusion | 104.3 kJ/mol | specific heat of fusion | 0.3924 kJ/g | (at STP)
Chemical identifiers
O[Nb](=O)=O InChI identifier | InChI=1/2Nb.5O/rNb2O5/c3-1(4)7-2(5)6 RTECS number | QU0500000 MDL number | MFCD00011128](../image_source/a1c390bdb01c7acdf5f000ed0f8e08db.png)
CAS number | 1313-96-8 PubChem CID number | 123105 PubChem SID number | 24852077 SMILES identifier | O=[Nb](=O)O[Nb](=O)=O InChI identifier | InChI=1/2Nb.5O/rNb2O5/c3-1(4)7-2(5)6 RTECS number | QU0500000 MDL number | MFCD00011128
Toxicity properties
RTECS classes | other