Input interpretation
tetrabromoterephthalic acid
Chemical names and formulas
formula | C_6Br_4(CO_2H)_2 Hill formula | C_8H_2Br_4O_4 name | tetrabromoterephthalic acid IUPAC name | 2, 3, 5, 6-tetrabromoterephthalic acid alternate names | 2, 3, 5, 6-tetrabromoterephthalic acid mass fractions | Br (bromine) 66.3% | C (carbon) 19.9% | H (hydrogen) 0.419% | O (oxygen) 13.3%
Lewis structure
Draw the Lewis structure of tetrabromoterephthalic acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the bromine (n_Br, val = 7), carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 4 n_Br, val + 8 n_C, val + 2 n_H, val + 4 n_O, val = 86 Calculate the number of electrons needed to completely fill the valence shells for bromine (n_Br, full = 8), carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 4 n_Br, full + 8 n_C, full + 2 n_H, full + 4 n_O, full = 132 Subtracting these two numbers shows that 132 - 86 = 46 bonding electrons are needed. Each bond has two electrons, so in addition to the 18 bonds already present in the diagram add 5 bonds. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 5 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 481.72 g/mol melting point | 350 °C
Units
Chemical identifiers
CAS number | 5411-70-1 PubChem CID number | 224162 PubChem SID number | 24874413 SMILES identifier | C1(=C(C(=C(C(=C1Br)Br)C(=O)O)Br)Br)C(=O)O InChI identifier | InChI=1/C8H2Br4O4/c9-3-1(7(13)14)4(10)6(12)2(5(3)11)8(15)16/h(H, 13, 14)(H, 15, 16)/f/h13, 15H MDL number | MFCD00059637