perfluoropentadecane

perfluoropentadecane

formula | CF_3(CF_2)_13CF_3 Hill formula | C_15F_32 name | perfluoropentadecane IUPAC name | 1, 1, 1, 2, 2, 3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 13, 13, 14, 14, 15, 15, 15-dotriacontafluoropentadecane alternate names | 1, 1, 1, 2, 2, 3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 13, 13, 14, 14, 15, 15, 15-dotriacontafluoropentadecane | dotriacontafluoropentadecane mass fractions | C (carbon) 22.9% | F (fluorine) 77.1%

Draw the Lewis structure of perfluoropentadecane. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4) and fluorine (n_F, val = 7) atoms: 15 n_C, val + 32 n_F, val = 284 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8) and fluorine (n_F, full = 8): 15 n_C, full + 32 n_F, full = 376 Subtracting these two numbers shows that 376 - 284 = 92 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 46 bonds and hence 92 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 284 - 92 = 192 electrons left to draw: Answer: | |

3D structure

molar mass | 788.11 g/mol phase | solid (at STP) melting point | 111.5 °C boiling point | 228 °C

CAS number | 2264-03-1 PubChem CID number | 2760326 PubChem SID number | 24868297 SMILES identifier | C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F InChI identifier | InChI=1/C15F32/c16-1(17, 2(18, 19)4(22, 23)6(26, 27)8(30, 31)10(34, 35)12(38, 39)14(42, 43)44)3(20, 21)5(24, 25)7(28, 29)9(32, 33)11(36, 37)13(40, 41)15(45, 46)47 MDL number | MFCD00239439