Search

SMILES identifier of 1,3-butadiene vs 2,2,4,4,6,8,8-heptamethylnonane

Input interpretation

1, 3-butadiene 2, 2, 4, 4, 6, 8, 8-heptamethylnonane | SMILES identifier
1, 3-butadiene 2, 2, 4, 4, 6, 8, 8-heptamethylnonane | SMILES identifier

Results

1, 3-butadiene | C=CC=C 2, 2, 4, 4, 6, 8, 8-heptamethylnonane | CC(CC(C)(C)C)CC(C)(C)CC(C)(C)C
1, 3-butadiene | C=CC=C 2, 2, 4, 4, 6, 8, 8-heptamethylnonane | CC(CC(C)(C)C)CC(C)(C)CC(C)(C)C

Random Queries

color of skippenite
ion class of hypophosphate anion vs hydrogen sulfate anion
alternate names of chloroacetic acid
net ionic charge of copper(II) cation vs copper(III) cation
lethal dosage of sodium bicarbonate
ion class of palladium(III) cation vs palladium(II) cation
CAS number of potassium chlorate vs cerium(III) perchlorate hexahydrate
stable isotopes of germanium
common source of ion of peroxide anion vs acetate anion
formula of herbertsmithite