Search

SMILES identifier of 1,3-butadiene vs 2,2,4,4,6,8,8-heptamethylnonane

Input interpretation

1, 3-butadiene 2, 2, 4, 4, 6, 8, 8-heptamethylnonane | SMILES identifier
1, 3-butadiene 2, 2, 4, 4, 6, 8, 8-heptamethylnonane | SMILES identifier

Results

1, 3-butadiene | C=CC=C 2, 2, 4, 4, 6, 8, 8-heptamethylnonane | CC(CC(C)(C)C)CC(C)(C)CC(C)(C)C
1, 3-butadiene | C=CC=C 2, 2, 4, 4, 6, 8, 8-heptamethylnonane | CC(CC(C)(C)C)CC(C)(C)CC(C)(C)C

Random Queries

molar mass of rhodium(III) iodide vs sodium hexafluorophosphate
H2O + KOH + Al + KNO2 = NH3 + K
unit cell lengths of admontite
CAS number of N-benzylcinchoninium chloride vs 2-methyl-9-acridinecarboxaldehyde
ions of mercury(I) nitrate vs sodium chlorate
water vs ethanol vs acetone vs methanol vs heavy water
boiling point of D-alpha-tocopherol
Al + C = Al4C
structure diagram of cobalt(III) cation vs oxide anion
phase of 1,2-dimethoxyethane