Input interpretation
![potassium dichromate](../image_source/48cc227981ffcbce46c2702c418fd68d.png)
potassium dichromate
Chemical names and formulas
![formula | K_2Cr_2O_7 Hill formula | Cr_2K_2O_7 name | potassium dichromate IUPAC name | dipotassium oxido-(oxido-dioxochromio)oxy-dioxochromium alternate names | bichromate of potash | dipotassium bichromate | dipotassium oxido-(oxido-dioxo-chromio)oxy-dioxo-chromium | potassium bichromate | potassium dichromate(VI) mass fractions | Cr (chromium) 35.3% | K (potassium) 26.6% | O (oxygen) 38.1%](../image_source/9087901e39b203bdafc13b18b6bf04ac.png)
formula | K_2Cr_2O_7 Hill formula | Cr_2K_2O_7 name | potassium dichromate IUPAC name | dipotassium oxido-(oxido-dioxochromio)oxy-dioxochromium alternate names | bichromate of potash | dipotassium bichromate | dipotassium oxido-(oxido-dioxo-chromio)oxy-dioxo-chromium | potassium bichromate | potassium dichromate(VI) mass fractions | Cr (chromium) 35.3% | K (potassium) 26.6% | O (oxygen) 38.1%
Structure diagram
![Structure diagram](../image_source/05c0a5b1e664e3e0459a0f5ce378a4e5.png)
Structure diagram
![vertex count | 11 edge count | 8 Schultz index | 322 Wiener index | 88 Hosoya index | 24 Balaban index | 3.746](../image_source/a36d4984679d960981e245b5a95060e9.png)
vertex count | 11 edge count | 8 Schultz index | 322 Wiener index | 88 Hosoya index | 24 Balaban index | 3.746
Basic properties
![molar mass | 294.18 g/mol phase | solid (at STP) melting point | 398 °C density | 2.67 g/cm^3](../image_source/ac97e9b1bb8a4265f665151a70b9301a.png)
molar mass | 294.18 g/mol phase | solid (at STP) melting point | 398 °C density | 2.67 g/cm^3
Units
Solid properties (at STP)
![density | 2.67 g/cm^3](../image_source/3b6c79c0d1b901293299407254d680dd.png)
density | 2.67 g/cm^3
Units
Thermodynamic properties
![molar heat of fusion | 36.6 kJ/mol specific heat of fusion | 0.1244 kJ/g (at STP)](../image_source/244fa6675cc8f3a251ef7783e975587a.png)
molar heat of fusion | 36.6 kJ/mol specific heat of fusion | 0.1244 kJ/g (at STP)
Chemical identifiers
![CAS number | 7778-50-9 PubChem CID number | 516855 SMILES identifier | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] InChI identifier | InChI=1/2Cr.2K.7O/q;;2*+1;;;;;;2*-1/rCr2O7.2K/c3-1(4, 5)9-2(6, 7)8;;/q-2;2*+1 RTECS number | HX7680000 MDL number | MFCD00011367](../image_source/5de6fcaa7e488b34e06c346a989235e4.png)
CAS number | 7778-50-9 PubChem CID number | 516855 SMILES identifier | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] InChI identifier | InChI=1/2Cr.2K.7O/q;;2*+1;;;;;;2*-1/rCr2O7.2K/c3-1(4, 5)9-2(6, 7)8;;/q-2;2*+1 RTECS number | HX7680000 MDL number | MFCD00011367
NFPA label
![NFPA label](../image_source/ae53a3b8037b89c12241f9e062df1e1d.png)
NFPA label
![NFPA health rating | 4 NFPA fire rating | 0 NFPA reactivity rating | 1 NFPA hazards | oxidizing agent](../image_source/35e5cdcbc973df9a5f5d202dee5f72d1.png)
NFPA health rating | 4 NFPA fire rating | 0 NFPA reactivity rating | 1 NFPA hazards | oxidizing agent
Toxicity properties
![odor | odorless](../image_source/9c7d566e0c5e583527c31e2e98887c85.png)
odor | odorless
![RTECS classes | tumorigen | mutagen | reproductive effector | human data](../image_source/41339cbb20d5a924a77b05a21ceae03a.png)
RTECS classes | tumorigen | mutagen | reproductive effector | human data
Ion equivalents
![(Cr_2O_7)^(2-) (dichromate anion) | 1 K^+ (potassium cation) | 2](../image_source/835b691db55f205a83a7b184a2a70368.png)
(Cr_2O_7)^(2-) (dichromate anion) | 1 K^+ (potassium cation) | 2