Input interpretation
potassium dichromate
Chemical names and formulas
formula | K_2Cr_2O_7 Hill formula | Cr_2K_2O_7 name | potassium dichromate IUPAC name | dipotassium oxido-(oxido-dioxochromio)oxy-dioxochromium alternate names | bichromate of potash | dipotassium bichromate | dipotassium oxido-(oxido-dioxo-chromio)oxy-dioxo-chromium | potassium bichromate | potassium dichromate(VI) mass fractions | Cr (chromium) 35.3% | K (potassium) 26.6% | O (oxygen) 38.1%
Structure diagram
Structure diagram
vertex count | 11 edge count | 8 Schultz index | 322 Wiener index | 88 Hosoya index | 24 Balaban index | 3.746
Basic properties
molar mass | 294.18 g/mol phase | solid (at STP) melting point | 398 °C density | 2.67 g/cm^3
Units
Solid properties (at STP)
density | 2.67 g/cm^3
Units
Thermodynamic properties
molar heat of fusion | 36.6 kJ/mol specific heat of fusion | 0.1244 kJ/g (at STP)
Chemical identifiers
![CAS number | 7778-50-9 PubChem CID number | 516855 SMILES identifier | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] InChI identifier | InChI=1/2Cr.2K.7O/q;;2*+1;;;;;;2*-1/rCr2O7.2K/c3-1(4, 5)9-2(6, 7)8;;/q-2;2*+1 RTECS number | HX7680000 MDL number | MFCD00011367](../image_source/5de6fcaa7e488b34e06c346a989235e4.png)
CAS number | 7778-50-9 PubChem CID number | 516855 SMILES identifier | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] InChI identifier | InChI=1/2Cr.2K.7O/q;;2*+1;;;;;;2*-1/rCr2O7.2K/c3-1(4, 5)9-2(6, 7)8;;/q-2;2*+1 RTECS number | HX7680000 MDL number | MFCD00011367
NFPA label
NFPA label
NFPA health rating | 4 NFPA fire rating | 0 NFPA reactivity rating | 1 NFPA hazards | oxidizing agent
Toxicity properties
odor | odorless
RTECS classes | tumorigen | mutagen | reproductive effector | human data
Ion equivalents
(Cr_2O_7)^(2-) (dichromate anion) | 1 K^+ (potassium cation) | 2