Input interpretation
isobutane | 3, 3-dimethylheptane
Chemical names and formulas
| isobutane | 3, 3-dimethylheptane formula | (CH_3)_3CH | C_9H_20 Hill formula | C_4H_10 | C_9H_20 name | isobutane | 3, 3-dimethylheptane IUPAC name | isobutane | 3, 3-dimethylheptane alternate names | 1, 1-dimethylethane | 2-methylpropane | Freon 600a | propane, 2-methyl- | R-600a | trimethylmethane | heptane, 3, 3-dimethyl- mass fractions | C (carbon) 82.7% | H (hydrogen) 17.3% | C (carbon) 84.3% | H (hydrogen) 15.7%
Structure diagrams
| isobutane | 3, 3-dimethylheptane vertex count | 4 | 9 edge count | 3 | 8 Schultz index | 36 | 356 Wiener index | 9 | 98 Hosoya index | 4 | 41 Balaban index | 2.324 | 3.33
3D structure
3D structure
Basic properties
| isobutane | 3, 3-dimethylheptane molar mass | 58.12 g/mol | 128.26 g/mol phase | gas (at STP) | liquid (at STP) melting point | -160 °C | boiling point | -12 °C | 137 °C density | 0.00251 g/cm^3 | 0.7254 g/cm^3 solubility in water | slightly soluble | insoluble
Units
Gas properties
| isobutane density | 0.00251 g/cm^3 vapor density | 2.01 molar volume | 23200 cm^3/mol surface tension | 0.0141 N/m refractive index | 1.3518 dynamic viscosity | 7.498×10^-6 Pa s
Units
Liquid properties
| 3, 3-dimethylheptane density | 0.7254 g/cm^3 vapor pressure | 8.9 mmHg refractive index | 1.4087
Units
Thermodynamic properties
| isobutane | 3, 3-dimethylheptane molar heat of vaporization | 21.3 kJ/mol (kilojoules per mole) | 42.7 kJ/mol (kilojoules per mole) specific heat of vaporization | 0.366 kJ/g (kilojoules per gram) | 0.333 kJ/g (kilojoules per gram) molar heat of combustion | 3061 kJ/mol (kilojoules per mole) | molar heat of fusion | 4.54 kJ/mol (kilojoules per mole) | critical temperature | 407.84 K (kelvins) | critical pressure | 3.629 MPa (megapascals) | compressibility factor | 0.282 (at critical conditions) | acentric factor ω | 0.177 | Antoine equation constants | 13.8137 | 2150.23 | -27.6228 |
Chemical identifiers
| isobutane | 3, 3-dimethylheptane CAS number | 75-28-5 | 4032-86-4 Beilstein number | 1730720 | 3199982 PubChem CID number | 6360 | 520991 PubChem SID number | 24857785 | SMILES identifier | CC(C)C | CCCCC(C)(C)CC InChI identifier | InChI=1/C4H10/c1-4(2)3/h4H, 1-3H3 | InChI=1/C9H20/c1-5-7-8-9(3, 4)6-2/h5-8H2, 1-4H3 RTECS number | TZ4300000 | MDL number | MFCD00008926 |
NFPA label
NFPA label