Search

tetrabutylphosphonium chloride

Input interpretation

tetrabutylphosphonium chloride
tetrabutylphosphonium chloride

Chemical names and formulas

formula | (CH_3CH_2CH_2CH_2)_4P(Cl) Hill formula | C_16ClH_36P name | tetrabutylphosphonium chloride alternate names | tetrabutylphosphanium hydrochloride | tetrabutylphosphonium hydrochloride mass fractions | C (carbon) 65.2% | Cl (chlorine) 12% | H (hydrogen) 12.3% | P (phosphorus) 10.5%
formula | (CH_3CH_2CH_2CH_2)_4P(Cl) Hill formula | C_16ClH_36P name | tetrabutylphosphonium chloride alternate names | tetrabutylphosphanium hydrochloride | tetrabutylphosphonium hydrochloride mass fractions | C (carbon) 65.2% | Cl (chlorine) 12% | H (hydrogen) 12.3% | P (phosphorus) 10.5%

Structure diagram

Structure diagram
Structure diagram
vertex count | 18 edge count | 16 Schultz index | 2036 Wiener index | 560 Hosoya index | 2125 Balaban index | 4.391
vertex count | 18 edge count | 16 Schultz index | 2036 Wiener index | 560 Hosoya index | 2125 Balaban index | 4.391

Basic properties

molar mass | 294.89 g/mol phase | solid (at STP) melting point | 64 °C
molar mass | 294.89 g/mol phase | solid (at STP) melting point | 64 °C

Units

Chemical identifiers

CAS number | 2304-30-5 Beilstein number | 4019186 SMILES identifier | CCCC[P+](CCCC)(CCCC)CCCC.[Cl-] RTECS number | TA2419000 MDL number | MFCD00011854
CAS number | 2304-30-5 Beilstein number | 4019186 SMILES identifier | CCCC[P+](CCCC)(CCCC)CCCC.[Cl-] RTECS number | TA2419000 MDL number | MFCD00011854

Random Queries

mass fractions of zinc chlorate
molar heat of vaporization of promethium
DOT numbers of carbon dioxide
molar mass of selenium(II) cation vs lead(IV) cation
longest aliphatic chain length of iron(II) oxide vs titanium(IV) oxide (rutile)
IUPAC name of soda ash vs pearl ash
structure diagram of alcohol functional group
formula of gray arsenic
freezing point of sodium tungstate vs calcium oxalate monohydrate
atomic radius of barium vs cerium