Search

name of calcium carbonate

Input interpretation

calcium carbonate
calcium carbonate

Chemical names and formulas

formula | CaCO_3 Hill formula | CCaO_3 name | calcium carbonate alternate names | calcite | chalk | limestone | marble | pearl | aeromatt mass fractions | C (carbon) 12% | Ca (calcium) 40% | O (oxygen) 48%
formula | CaCO_3 Hill formula | CCaO_3 name | calcium carbonate alternate names | calcite | chalk | limestone | marble | pearl | aeromatt mass fractions | C (carbon) 12% | Ca (calcium) 40% | O (oxygen) 48%

Structure diagram

Structure diagram
Structure diagram
vertex count | 5 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
vertex count | 5 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324

Basic properties

molar mass | 100.09 g/mol phase | solid (at STP) melting point | 1340 °C density | 2.71 g/cm^3 solubility in water | insoluble
molar mass | 100.09 g/mol phase | solid (at STP) melting point | 1340 °C density | 2.71 g/cm^3 solubility in water | insoluble

Units

Solid properties (at STP)

density | 2.71 g/cm^3
density | 2.71 g/cm^3

Units

Thermodynamic properties

specific heat capacity c_p | solid | 0.8343 J/(g K) molar heat capacity c_p | solid | 83.5 J/(mol K) specific free energy of formation Δ_fG° | solid | -11.28 kJ/g molar free energy of formation Δ_fG° | solid | -1129 kJ/mol specific heat of formation Δ_fH° | solid | -12.07 kJ/g molar heat of formation Δ_fH° | solid | -1208 kJ/mol specific entropy S° | solid | 0.9162 J/(g K) molar entropy S° | solid | 91.7 J/(mol K) molar heat of fusion | 36 kJ/mol |  specific heat of fusion | 0.36 kJ/g |  (at STP)
specific heat capacity c_p | solid | 0.8343 J/(g K) molar heat capacity c_p | solid | 83.5 J/(mol K) specific free energy of formation Δ_fG° | solid | -11.28 kJ/g molar free energy of formation Δ_fG° | solid | -1129 kJ/mol specific heat of formation Δ_fH° | solid | -12.07 kJ/g molar heat of formation Δ_fH° | solid | -1208 kJ/mol specific entropy S° | solid | 0.9162 J/(g K) molar entropy S° | solid | 91.7 J/(mol K) molar heat of fusion | 36 kJ/mol | specific heat of fusion | 0.36 kJ/g | (at STP)

Chemical identifiers

CAS number | 471-34-1 Beilstein number | 8008338 PubChem CID number | 10112 SMILES identifier | C(=O)([O-])[O-].[Ca+2] InChI identifier | InChI=1/CH2O3.Ca/c2-1(3)4;/h(H2, 2, 3, 4);/q;+2/p-2/fCO3.Ca/q-2;m EU number | 215-279-6 Gmelin number | 8544 RTECS number | FF9335000 MDL number | MFCD00010906
CAS number | 471-34-1 Beilstein number | 8008338 PubChem CID number | 10112 SMILES identifier | C(=O)([O-])[O-].[Ca+2] InChI identifier | InChI=1/CH2O3.Ca/c2-1(3)4;/h(H2, 2, 3, 4);/q;+2/p-2/fCO3.Ca/q-2;m EU number | 215-279-6 Gmelin number | 8544 RTECS number | FF9335000 MDL number | MFCD00010906

NFPA label

NFPA label
NFPA label
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0
NFPA health rating | 1 NFPA fire rating | 0 NFPA reactivity rating | 0

Toxicity properties

lethal dosage | 6450 mg/kg (oral dose for rats)
lethal dosage | 6450 mg/kg (oral dose for rats)
probable lethal dose for man | 1 L (liter) RTECS classes | primary irritant
probable lethal dose for man | 1 L (liter) RTECS classes | primary irritant

Ion equivalents

Ca^(2+) (calcium cation) | 1 (CO_3)^(2-) (carbonate anion) | 1
Ca^(2+) (calcium cation) | 1 (CO_3)^(2-) (carbonate anion) | 1