Search

rhodamine B

Input interpretation

rhodamine B
rhodamine B

Chemical names and formulas

formula | C_28H_31N_2O_3Cl Hill formula | C_28H_31ClN_2O_3 name | rhodamine B IUPAC name | [9-(2-carboxyphenyl)-6-diethylamino-xanthen-3-ylidene]-diethyl-azanium chloride alternate names | basic violet 10 | C.I. basic violet 10 | rhodamine mass fractions | C (carbon) 70.2% | Cl (chlorine) 7.4% | H (hydrogen) 6.52% | N (nitrogen) 5.85% | O (oxygen) 10%
formula | C_28H_31N_2O_3Cl Hill formula | C_28H_31ClN_2O_3 name | rhodamine B IUPAC name | [9-(2-carboxyphenyl)-6-diethylamino-xanthen-3-ylidene]-diethyl-azanium chloride alternate names | basic violet 10 | C.I. basic violet 10 | rhodamine mass fractions | C (carbon) 70.2% | Cl (chlorine) 7.4% | H (hydrogen) 6.52% | N (nitrogen) 5.85% | O (oxygen) 10%

Structure diagram

Structure diagram
Structure diagram
vertex count | 34 edge count | 37 Schultz index | 12350 Wiener index | 2944 Hosoya index | 8.801×10^6 Balaban index | 1.593
vertex count | 34 edge count | 37 Schultz index | 12350 Wiener index | 2944 Hosoya index | 8.801×10^6 Balaban index | 1.593

Basic properties

molar mass | 479 g/mol phase | solid (at STP) melting point | 200 °C density | 1 g/cm^3 solubility in water | very soluble
molar mass | 479 g/mol phase | solid (at STP) melting point | 200 °C density | 1 g/cm^3 solubility in water | very soluble

Units

Solid properties (at STP)

density | 1 g/cm^3
density | 1 g/cm^3

Units

Chemical identifiers

CAS number | 81-88-9 Beilstein number | 4119648 PubChem CID number | 6694 SMILES identifier | CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=CC=CC=C4C(=O)O.[Cl-] InChI identifier | InChI=1/C28H30N2O3.ClH/c1-5-29(6-2)19-13-15-23-25(17-19)33-26-18-20(30(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(31)32;/h9-18H, 5-8H2, 1-4H3;1H/fC28H31N2O3.Cl/h31H;1h/q+1;-1 EU number | 201-383-9 RTECS number | BP3675000 NSC number | 10475
CAS number | 81-88-9 Beilstein number | 4119648 PubChem CID number | 6694 SMILES identifier | CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=CC=CC=C4C(=O)O.[Cl-] InChI identifier | InChI=1/C28H30N2O3.ClH/c1-5-29(6-2)19-13-15-23-25(17-19)33-26-18-20(30(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(31)32;/h9-18H, 5-8H2, 1-4H3;1H/fC28H31N2O3.Cl/h31H;1h/q+1;-1 EU number | 201-383-9 RTECS number | BP3675000 NSC number | 10475

NFPA label

NFPA label
NFPA label
NFPA health rating | 2 NFPA fire rating | 0 NFPA reactivity rating | 0
NFPA health rating | 2 NFPA fire rating | 0 NFPA reactivity rating | 0

Toxicity properties

RTECS classes | agricultural chemical and pesticide | tumorigen | mutagen | reproductive effector
RTECS classes | agricultural chemical and pesticide | tumorigen | mutagen | reproductive effector

Random Queries

IUPAC name of thallium(III) hydroxide
formula of barium N-acetylneuraminate vs zinc dibutyldithiocarbamate
chemical types of lithium 2-thienylcyanocuprate vs ferric nitrate
magnesium oxide
DOT hazard class of rubidium hydroxide vs butyllithium
freezing point of potassium bifluoride
total number of electrons of aluminum cation
foresting components image linarite
molar mass of copper(II) telluride vs silver perchlorate hydrate
element types of sodium bromate vs potassium fluoride