Search

SMILES identifier of 16-hydroxytabersonine vs D-glucosamine-1-13 chydrochloride

Input interpretation

16-hydroxytabersonine D-glucosamine-1-13 chydrochloride | SMILES identifier
16-hydroxytabersonine D-glucosamine-1-13 chydrochloride | SMILES identifier

Results

16-hydroxytabersonine | CCC12CC(=C3C4(C1N(CC4)CC=C2)C5=C(N3)C=C(C=C5)O)C(=O)OC D-glucosamine-1-13 chydrochloride | C(C1C(C(C(C(O1)O)N)O)O)O.Cl
16-hydroxytabersonine | CCC12CC(=C3C4(C1N(CC4)CC=C2)C5=C(N3)C=C(C=C5)O)C(=O)OC D-glucosamine-1-13 chydrochloride | C(C1C(C(C(C(O1)O)N)O)O)O.Cl

Random Queries

atomic radius of ruthenium vs iron
common sources of ion of chromium(III) cation
name of pentabromodiphenyl ether
H2O + NaI + NaIO3 = NaOH + I2
radioactives of group 10 elements
group 13 elements
H2SO4 + K2Cr2O7 + Mg = H2O + K2SO4 + S + Cr2(SO4)3 + MgSO4
bond types of soda ash vs cesium hydroxide
alternate names of tellurium(V) cation
scandium(III) cation vs bromide anion vs iron(II) cation