Search

InChI identifier of firefly luciferin

Input interpretation

firefly luciferin | InChI identifier
firefly luciferin | InChI identifier

Result

InChI=1/C11H8N2O3S2/c14-5-1-2-6-8(3-5)18-10(12-6)9-13-7(4-17-9)11(15)16/h1-3, 7, 13H, 4H2, (H, 15, 16)/b10-9+/t7-/m1/s1/f/h15H
InChI=1/C11H8N2O3S2/c14-5-1-2-6-8(3-5)18-10(12-6)9-13-7(4-17-9)11(15)16/h1-3, 7, 13H, 4H2, (H, 15, 16)/b10-9+/t7-/m1/s1/f/h15H

Random Queries

CAS number of gadolinium(III) acetate hydrate
boiling point of vinyl bromide vs fluorocyclohexane
Hill formula string of lucifer yellow cH vs ammonium-15 nbromide
H2SO4 + KMnO4 + K4Fe(CN)6 = H2O + HNO3 + CO2 + MnSO4 + Fe2(SO4)3 + KHSO4
(ion class of electrophilic alkene functional group)/(net ionic charge of electrophilic alkene functional group)
DOT numbers of scandium antimonide vs uranium pentafluoride
2,2-bis(3-amino-4-hydroxyphenyl)hexafluoropropane vs 2-amino-5-chlorobenzoic acid
common sources of ion of alkaline earth metal ions
chemical types dysprosium silicide
edge count of tetraphenylphosphonium bromide