Search

name of iron(II) carbonate

Input interpretation

iron(II) carbonate
iron(II) carbonate

Chemical names and formulas

formula | FeCO_3 Hill formula | CFeO_3 name | iron(II) carbonate IUPAC name | ferrous carbonate alternate names | iron(+2) cation carbonate mass fractions | C (carbon) 10.4% | Fe (iron) 48.2% | O (oxygen) 41.4%
formula | FeCO_3 Hill formula | CFeO_3 name | iron(II) carbonate IUPAC name | ferrous carbonate alternate names | iron(+2) cation carbonate mass fractions | C (carbon) 10.4% | Fe (iron) 48.2% | O (oxygen) 41.4%

Structure diagram

Structure diagram
Structure diagram
vertex count | 5 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324
vertex count | 5 edge count | 3 Schultz index | 36 Wiener index | 9 Hosoya index | 4 Balaban index | 2.324

Basic properties

molar mass | 115.85 g/mol
molar mass | 115.85 g/mol

Units

Chemical identifiers

CAS number | 563-71-3 PubChem CID number | 11248 SMILES identifier | C(=O)([O-])[O-].[Fe+2] InChI identifier | InChI=1/CH2O3.Fe/c2-1(3)4;/h(H2, 2, 3, 4);/q;+2/p-2/fCO3.Fe/q-2;m
CAS number | 563-71-3 PubChem CID number | 11248 SMILES identifier | C(=O)([O-])[O-].[Fe+2] InChI identifier | InChI=1/CH2O3.Fe/c2-1(3)4;/h(H2, 2, 3, 4);/q;+2/p-2/fCO3.Fe/q-2;m

Ion equivalents

Fe^(2+) (iron(II) cation) | 1 (CO_3)^(2-) (carbonate anion) | 1
Fe^(2+) (iron(II) cation) | 1 (CO_3)^(2-) (carbonate anion) | 1