Input interpretation
2-ethoxyethyl acetate
Chemical names and formulas
formula | CH_3COOCH_2CH_2OC_2H_5 Hill formula | C_6H_12O_3 name | 2-ethoxyethyl acetate IUPAC name | acetic acid 2-ethoxyethyl ester alternate names | 1-acetoxy-2-ethoxyethane | 2-ethoxyethyl ethanoate | acetic acid 2-ethoxyethyl ester | Cellosolve®acetate | ethylene glycol monoethyl ether acetate mass fractions | C (carbon) 54.5% | H (hydrogen) 9.15% | O (oxygen) 36.3%
Lewis structure
Draw the Lewis structure of 2-ethoxyethyl acetate. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the carbon (n_C, val = 4), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 6 n_C, val + 12 n_H, val + 3 n_O, val = 54 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 6 n_C, full + 12 n_H, full + 3 n_O, full = 96 Subtracting these two numbers shows that 96 - 54 = 42 bonding electrons are needed. Each bond has two electrons, so in addition to the 20 bonds already present in the diagram add 1 bond. To minimize formal charge oxygen wants 2 bonds and carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 1 bond by pairing electrons between adjacent highlighted atoms: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 132.16 g/mol phase | liquid (at STP) melting point | -61 °C boiling point | 156 °C density | 0.975 g/cm^3 dielectric constant | 7.57
Liquid properties (at STP)
density | 0.975 g/cm^3 vapor pressure | 2 mmHg refractive index | 1.406
Units
Thermodynamic properties
molar heat of vaporization | 39.3 kJ/mol specific heat of vaporization | 0.2974 kJ/g critical temperature | 608 K critical pressure | 3.17 MPa (at STP)
Chemical identifiers
CAS number | 111-15-9 Beilstein number | 1748677 PubChem CID number | 8095 PubChem SID number | 24846949 SMILES identifier | CCOCCOC(=O)C InChI identifier | InChI=1/C6H12O3/c1-3-8-4-5-9-6(2)7/h3-5H2, 1-2H3 RTECS number | KK8225000 MDL number | MFCD00009251
Safety properties
flash point | 57.22 °C
Toxicity properties
odor | mild threshold limit value | 5 ppmv
Units
