Search

SMILES identifier of 4-O-acetyl-3,6-di-O-(tert-butyldimethylsilyl)-D-glucal vs 2,2,3,4,4,4-hexafluorobutan-1-ol

Input interpretation

4-O-acetyl-3, 6-di-O-(tert-butyldimethylsilyl)-D-glucal 2, 2, 3, 4, 4, 4-hexafluorobutan-1-ol | SMILES identifier
4-O-acetyl-3, 6-di-O-(tert-butyldimethylsilyl)-D-glucal 2, 2, 3, 4, 4, 4-hexafluorobutan-1-ol | SMILES identifier

Results

4-O-acetyl-3, 6-di-O-(tert-butyldimethylsilyl)-D-glucal | CC(=O)OC1C(C=COC1CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C 2, 2, 3, 4, 4, 4-hexafluorobutan-1-ol | C(C(C(C(F)(F)F)F)(F)F)O
4-O-acetyl-3, 6-di-O-(tert-butyldimethylsilyl)-D-glucal | CC(=O)OC1C(C=COC1CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C 2, 2, 3, 4, 4, 4-hexafluorobutan-1-ol | C(C(C(C(F)(F)F)F)(F)F)O

Random Queries

melting point of cesium vs sodium
edge types of fast violet Bsalt vs (toluene)tricarbonylchromium(0)
chemical types of 1,2-dichlorotetrafluoroethane
formula of alkyl iodide functional group vs alkyl bromide functional group
CAS number of gallamine triethiodide
add deuteranopia color blindness filter to a picture of an acuminite
formula of osmium(I) cation vs ruthenium(I) cation
NH4Cl + (CuOH)2CO3 = H2O + CO2 + Cu + N2 + CuCl2
electronegativity of hydrogen vs lithium
alternate names of thallous nitrate vs barium chloride