Search

SMILES identifier of 4-O-acetyl-3,6-di-O-(tert-butyldimethylsilyl)-D-glucal vs 2,2,3,4,4,4-hexafluorobutan-1-ol

Input interpretation

4-O-acetyl-3, 6-di-O-(tert-butyldimethylsilyl)-D-glucal 2, 2, 3, 4, 4, 4-hexafluorobutan-1-ol | SMILES identifier
4-O-acetyl-3, 6-di-O-(tert-butyldimethylsilyl)-D-glucal 2, 2, 3, 4, 4, 4-hexafluorobutan-1-ol | SMILES identifier

Results

4-O-acetyl-3, 6-di-O-(tert-butyldimethylsilyl)-D-glucal | CC(=O)OC1C(C=COC1CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C 2, 2, 3, 4, 4, 4-hexafluorobutan-1-ol | C(C(C(C(F)(F)F)F)(F)F)O
4-O-acetyl-3, 6-di-O-(tert-butyldimethylsilyl)-D-glucal | CC(=O)OC1C(C=COC1CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C 2, 2, 3, 4, 4, 4-hexafluorobutan-1-ol | C(C(C(C(F)(F)F)F)(F)F)O

Random Queries

atomic radius of barium vs ytterbium
adelite
carbon common compound
Cl2 + KOH + FeS2 = H2O + K2SO4 + KCl + K2FeO4
alternate names of scandium vs sulfur
density of 4-O-acetyl-3,6-di-O-(tert-butyldimethylsilyl)-D-glucal
freezing point of valeric acid
alternate names of potassium iodide vs sodium fluoride
formula of copper(III) cation vs palladium(IV) cation
ion class of hexaaquamanganese(II) cation vs dicyanoaurate(I) anion