name of 5-bromo-2-chloroanisole

5-bromo-2-chloroanisole

formula | BrC_6H_3(Cl)OCH_3 Hill formula | C_7H_6BrClO name | 5-bromo-2-chloroanisole IUPAC name | 4-bromo-1-chloro-2-methoxybenzene alternate names | 4-bromo-1-chloro-2-methoxy-benzene | 4-bromo-1-chloro-2-methoxybenzene mass fractions | Br (bromine) 36.1% | C (carbon) 38% | Cl (chlorine) 16% | H (hydrogen) 2.73% | O (oxygen) 7.22%

Draw the Lewis structure of 5-bromo-2-chloroanisole. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the bromine (n_Br, val = 7), carbon (n_C, val = 4), chlorine (n_Cl, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: n_Br, val + 7 n_C, val + n_Cl, val + 6 n_H, val + n_O, val = 54 Calculate the number of electrons needed to completely fill the valence shells for bromine (n_Br, full = 8), carbon (n_C, full = 8), chlorine (n_Cl, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): n_Br, full + 7 n_C, full + n_Cl, full + 6 n_H, full + n_O, full = 92 Subtracting these two numbers shows that 92 - 54 = 38 bonding electrons are needed. Each bond has two electrons, so in addition to the 16 bonds already present in the diagram add 3 bonds. To minimize formal charge carbon wants 4 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 3 bonds by pairing electrons between adjacent highlighted atoms. Note that the six atom ring is aromatic, so that the single and double bonds may be rearranged: Answer: | |

3D structure

molar mass | 221.48 g/mol phase | liquid (at STP) boiling point | 242.5 °C (measured at 99708 Pa) density | 1.631 g/cm^3

density | 1.631 g/cm^3 refractive index | 1.587

CAS number | 16817-43-9 PubChem CID number | 2769567 PubChem SID number | 24873584 SMILES identifier | COC1=C(C=CC(=C1)Br)Cl InChI identifier | InChI=1/C7H6BrClO/c1-10-7-4-5(8)2-3-6(7)9/h2-4H, 1H3 MDL number | MFCD00078659