name of bicyclo[3.3.1]nonane

bicyclo[3.3.1]nonane

formula | C_9H_16 name | bicyclo[3.3.1]nonane alternate names | bicyclo(3.3.1)nonane mass fractions | C (carbon) 87% | H (hydrogen) 13%

Draw the Lewis structure of bicyclo[3.3.1]nonane. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4) and hydrogen (n_H, val = 1) atoms: 9 n_C, val + 16 n_H, val = 52 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8) and hydrogen (n_H, full = 2): 9 n_C, full + 16 n_H, full = 104 Subtracting these two numbers shows that 104 - 52 = 52 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 26 bonds and hence 52 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 52 - 52 = 0 electrons left to draw and the diagram is complete: Answer: | |

3D structure

molar mass | 124.23 g/mol phase | liquid (at STP) boiling point | 169.5 °C density | 0.94 g/cm^3 solubility in water | insoluble

density | 0.94 g/cm^3

CAS number | 280-65-9 Beilstein number | 1900706 PubChem CID number | 136101 SMILES identifier | C1CC2CCCC(C1)C2 InChI identifier | InChI=1/C9H16/c1-3-8-5-2-6-9(4-1)7-8/h8-9H, 1-7H2