Search

SMILES identifier of sertraline vs flurbiprofen methyl ester

Input interpretation

sertraline flurbiprofen methyl ester | SMILES identifier
sertraline flurbiprofen methyl ester | SMILES identifier

Results

sertraline | CNC1CCC(C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl flurbiprofen methyl ester | CC(C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)OC
sertraline | CNC1CCC(C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl flurbiprofen methyl ester | CC(C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)OC

Random Queries

formula string of 2-pentyl isocyanide vs D-sorbitol
alternate names of geranyl bromide
InChI identifier of silver fulminate
atomic radius of scandium vs thulium
O2 + P4 = P2O5
CAS number of vanadium(II) iodide
atomic number of period 2 elements
NFPA label of acetic acid
atomic diameter of d-block elements
atomic number of plutonium vs americium