Search

SMILES identifier of sertraline vs flurbiprofen methyl ester

Input interpretation

sertraline flurbiprofen methyl ester | SMILES identifier
sertraline flurbiprofen methyl ester | SMILES identifier

Results

sertraline | CNC1CCC(C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl flurbiprofen methyl ester | CC(C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)OC
sertraline | CNC1CCC(C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl flurbiprofen methyl ester | CC(C1=CC(=C(C=C1)C2=CC=CC=C2)F)C(=O)OC

Random Queries

H2O + HNO3 + P = NO + H3PO3
alternate names of nitrogen vs boron trichloride
alternate names of lanthanum hexaboride
total number of protons of thallium(III) cation vs indium(I) cation
ionic radius of arsenic(V) cation
melting point of rubidium vs potassium
atomic mass of Hs-264 vs Pu-239
molar mass of barium titanate vs lithium zirconate
name of superoxide anion vs iodide anion
boiling point of 1,1-diphenylethane