Search

InChI identifier of isopentane

Input interpretation

isopentane | InChI identifier
isopentane | InChI identifier

Result

InChI=1/C5H12/c1-4-5(2)3/h5H, 4H2, 1-3H3
InChI=1/C5H12/c1-4-5(2)3/h5H, 4H2, 1-3H3

Random Queries

formula of manganese II nitrate chemical
HNO3 + Fe + N2O3 = H2O + Fe(NO3)3 + NH4NO3
alternate names of cesium hydroxide vs cesium
name of permanganate anion
name of quartz
H2O + Zr = H2 + ZrO2
H2O + As2O3 + HOCl = HCl + H3AsO4
formula of donovan's solution vs sodium trimetaphosphate
chemical types benzoic acid
name of antimonite anion