Search

InChI identifier of 4-bromo-3-fluorophenylzinc iodide

Input interpretation

4-bromo-3-fluorophenylzinc iodide | InChI identifier
4-bromo-3-fluorophenylzinc iodide | InChI identifier

Result

InChI=1/C6H3BrF.HI.Zn/c7-5-3-1-2-4-6(5)8;;/h1, 3-4H;1H;/q-1;;+2/p-1/fC6H3BrF.I.Zn/h;1h;/qm;-1;m/rC6H3BrF.IZn/c7-5-3-1-2-4-6(5)8;1-2/h1, 3-4H;/q-1;+1
InChI=1/C6H3BrF.HI.Zn/c7-5-3-1-2-4-6(5)8;;/h1, 3-4H;1H;/q-1;;+2/p-1/fC6H3BrF.I.Zn/h;1h;/qm;-1;m/rC6H3BrF.IZn/c7-5-3-1-2-4-6(5)8;1-2/h1, 3-4H;/q-1;+1

Random Queries

crystal class of allabogdanite
tin(IV) fluoride
crystal system of jervisite vs amstallite
surface tension of nitrogen
freezing point of germane
sulfite anion vs ammonium cation vs hydronium cation
chemical types of thulium(III) chloride hexahydrate
chemical uses of ethanol vs methanol
formula of iron(I) cation vs osmium(V) cation
molar mass of sulfate anion vs phosphate anion