Input interpretation
DL-methamphetamine
Chemical names and formulas
formula | C_10H_16ClN name | DL-methamphetamine IUPAC name | N-methyl-1-phenyl-propan-2-amine hydrochloride alternate names | methamphetamine mass fractions | C (carbon) 64.7% | Cl (chlorine) 19.1% | H (hydrogen) 8.69% | N (nitrogen) 7.54%
Structure diagram
Structure diagram
Basic properties
molar mass | 185.7 g/mol phase | solid (at STP) melting point | 136 °C
Units
Hydrophobicity and permeability properties
experimental LogP hydrophobicity | 2.07 predicted LogP hydrophobicity | 2.23 predicted LogS | -2.21
Basic drug properties
approval status | approved | illicit | small molecule drug categories | adrenergic agent | adrenergic uptake inhibitor | central nervous system stimulant | dopamine agent | dopamine uptake inhibitor | sympathomimetic dosage forms | oral: tablet
brand names | desoxyn | desyphed | desyphed hydrochloride | metamfetamine | metamfetamine-m | norodin | speed | stimulex addiction potential of drug | 98.5%
Chemical identifiers
CAS number | 300-42-5 Beilstein number | 4155698 PubChem CID number | 9306 PubChem SID number | 10318874 SMILES identifier | CC(CC1=CC=CC=C1)NC.Cl InChI identifier | InChI=1/C10H15N.ClH/c1-9(11-2)8-10-6-4-3-5-7-10;/h3-7, 9, 11H, 8H2, 1-2H3;1H InChI key | MYWUZJCMWCOHBA-VIFPVBQEBN EU number | 206-093-6 RTECS number | SH5075000 NSC number | 22367
Toxicity properties
RTECS classes | drug | reproductive effector | human data | primary irritant