Input interpretation
![metasilicic acid](../image_source/38b6d4d6696bda65130c1dd78f7f237b.png)
metasilicic acid
Chemical names and formulas
![formula | H_2O_3Si name | metasilicic acid IUPAC name | dihydroxy-oxo-silane alternate names | acid um silicicum | cubosic | silicic acid mass fractions | H (hydrogen) 2.58% | O (oxygen) 61.5% | Si (silicon) 36%](../image_source/15777821b1cc456f83608c150a1af129.png)
formula | H_2O_3Si name | metasilicic acid IUPAC name | dihydroxy-oxo-silane alternate names | acid um silicicum | cubosic | silicic acid mass fractions | H (hydrogen) 2.58% | O (oxygen) 61.5% | Si (silicon) 36%
Lewis structure
![Draw the Lewis structure of metasilicic acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the hydrogen (n_H, val = 1), oxygen (n_O, val = 6), and silicon (n_Si, val = 4) atoms: 2 n_H, val + 3 n_O, val + n_Si, val = 24 Calculate the number of electrons needed to completely fill the valence shells for hydrogen (n_H, full = 2), oxygen (n_O, full = 8), and silicon (n_Si, full = 8): 2 n_H, full + 3 n_O, full + n_Si, full = 36 Subtracting these two numbers shows that 36 - 24 = 12 bonding electrons are needed. Each bond has two electrons, so in addition to the 5 bonds already present in the diagram add 1 bond. To minimize formal charge silicon wants 4 bonds and oxygen wants 2 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 1 bond by pairing electrons between adjacent highlighted atoms: Answer: | |](../image_source/72e6f006d85766995da5c8c5ab778ffa.png)
Draw the Lewis structure of metasilicic acid. Start by drawing the overall structure of the molecule, ignoring potential double and triple bonds: Count the total valence electrons of the hydrogen (n_H, val = 1), oxygen (n_O, val = 6), and silicon (n_Si, val = 4) atoms: 2 n_H, val + 3 n_O, val + n_Si, val = 24 Calculate the number of electrons needed to completely fill the valence shells for hydrogen (n_H, full = 2), oxygen (n_O, full = 8), and silicon (n_Si, full = 8): 2 n_H, full + 3 n_O, full + n_Si, full = 36 Subtracting these two numbers shows that 36 - 24 = 12 bonding electrons are needed. Each bond has two electrons, so in addition to the 5 bonds already present in the diagram add 1 bond. To minimize formal charge silicon wants 4 bonds and oxygen wants 2 bonds. Identify the atoms that want additional bonds and the number of electrons remaining on each atom: Fill in the 1 bond by pairing electrons between adjacent highlighted atoms: Answer: | |
3D structure
![3D structure](../image_source/dbd7eb877a4a5857a783fe1ab17bd290.png)
3D structure
Basic properties
![molar mass | 78.098 g/mol phase | solid (at STP) melting point | 1704 °C density | 1 g/cm^3](../image_source/e0a5816d7348e23497d7baa48c9468f0.png)
molar mass | 78.098 g/mol phase | solid (at STP) melting point | 1704 °C density | 1 g/cm^3
Units
Solid properties (at STP)
![density | 1 g/cm^3](../image_source/225017f4e5b86f4332888b343ba25186.png)
density | 1 g/cm^3
Units
Thermodynamic properties
![specific free energy of formation Δ_fG° | solid | -13.99 kJ/g molar free energy of formation Δ_fG° | solid | -1092 kJ/mol specific heat of formation Δ_fH° | solid | -15.22 kJ/g molar heat of formation Δ_fH° | solid | -1189 kJ/mol (at STP)](../image_source/4e269d613197d2ddcd11bf6ce2dff524.png)
specific free energy of formation Δ_fG° | solid | -13.99 kJ/g molar free energy of formation Δ_fG° | solid | -1092 kJ/mol specific heat of formation Δ_fH° | solid | -15.22 kJ/g molar heat of formation Δ_fH° | solid | -1189 kJ/mol (at STP)
Chemical identifiers
![CAS number | 7699-41-4 PubChem CID number | 14768 SMILES identifier | O[Si](=O)O InChI identifier | InChI=1/H2O3Si/c1-4(2)3/h1-2H EU number | 231-716-3 Gmelin number | 42989 RTECS number | VV8850000](../image_source/d1dc76ad2f6ea3286ab6124cf557b378.png)
CAS number | 7699-41-4 PubChem CID number | 14768 SMILES identifier | O[Si](=O)O InChI identifier | InChI=1/H2O3Si/c1-4(2)3/h1-2H EU number | 231-716-3 Gmelin number | 42989 RTECS number | VV8850000
Toxicity properties
![RTECS classes | tumorigen | mutagen | primary irritant](../image_source/c36f73a1cc1a6b6470970bdcdb11d5ae.png)
RTECS classes | tumorigen | mutagen | primary irritant