Input interpretation
(S)-(-)-1, 1, 1, 2, 2-pentafluorododecan-3-ol
Chemical names and formulas
formula | CH_3(CH_2)_8CH(OH)CF_2CF_3 Hill formula | C_12H_21F_5O name | (S)-(-)-1, 1, 1, 2, 2-pentafluorododecan-3-ol IUPAC name | (3S)-1, 1, 1, 2, 2-pentafluorododecan-3-ol alternate names | (3S)-1, 1, 1, 2, 2-pentafluorododecan-3-ol mass fractions | C (carbon) 52.2% | F (fluorine) 34.4% | H (hydrogen) 7.66% | O (oxygen) 5.79%
Lewis structure
Draw the Lewis structure of (S)-(-)-1, 1, 1, 2, 2-pentafluorododecan-3-ol. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4), fluorine (n_F, val = 7), hydrogen (n_H, val = 1), and oxygen (n_O, val = 6) atoms: 12 n_C, val + 5 n_F, val + 21 n_H, val + n_O, val = 110 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8), fluorine (n_F, full = 8), hydrogen (n_H, full = 2), and oxygen (n_O, full = 8): 12 n_C, full + 5 n_F, full + 21 n_H, full + n_O, full = 186 Subtracting these two numbers shows that 186 - 110 = 76 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 38 bonds and hence 76 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 110 - 76 = 34 electrons left to draw: Answer: | |
3D structure
3D structure
Basic properties
molar mass | 276.29 g/mol phase | liquid (at STP) boiling point | 220 °C density | 1.1 g/cm^3
Units
Liquid properties (at STP)
density | 1.1 g/cm^3 refractive index | 1.391
Units
Chemical identifiers
CAS number | 307531-78-8 PubChem CID number | 16216952 PubChem SID number | 24877890 SMILES identifier | CCCCCCCCCC(C(C(F)(F)F)(F)F)O InChI identifier | InChI=1/C12H21F5O/c1-2-3-4-5-6-7-8-9-10(18)11(13, 14)12(15, 16)17/h10, 18H, 2-9H2, 1H3/t10-/m0/s1 MDL number | MFCD02183567
Safety properties
flash point | 107.8 °C