Search

InChI identifier of calcium phosphide vs tetrakis(dimethylamino)ethylene

Input interpretation

calcium phosphide tetrakis(dimethylamino)ethylene | InChI identifier
calcium phosphide tetrakis(dimethylamino)ethylene | InChI identifier

Results

calcium phosphide | InChI=1/3Ca.2P/q;;+2;2*-1/r2CaP.Ca/c2*1-2;/q2*-1;+2 tetrakis(dimethylamino)ethylene | InChI=1/C10H24N4/c1-11(2)9(12(3)4)10(13(5)6)14(7)8/h1-8H3
calcium phosphide | InChI=1/3Ca.2P/q;;+2;2*-1/r2CaP.Ca/c2*1-2;/q2*-1;+2 tetrakis(dimethylamino)ethylene | InChI=1/C10H24N4/c1-11(2)9(12(3)4)10(13(5)6)14(7)8/h1-8H3

Random Queries

chemical types of copper(II) nitrate vs stannous chloride dihydrate
Group 17
formula of 1,1,1-trifluoro-2-propanol
molar mass of hydrogen peroxide vs 1,3-bis(dicyclohexylphosphino)propane
molar mass of helium cation vs xenon(IV) cation
chemical types of sodium phosphide vs phosphocholine
longest chain length of 1, 1, 3-trichlorotrifluoroacetone
carbon, hydrogen, manganese
CAS number of gallium(III) perchlorate hexahydrate vs nitryl chloride
full electron configuration of bismuth