Input interpretation
![cyclopentane, 1, 2, 4-trimethyl](../image_source/d1ecac6cf95f0dcdae11f125ed1c0c9a.png)
cyclopentane, 1, 2, 4-trimethyl
Chemical names and formulas
![formula | C_8H_16 name | cyclopentane, 1, 2, 4-trimethyl IUPAC name | 1, 2, 4-trimethylcyclopentane alternate names | cyclopentane, 1, 2, 4-trimethyl-, cis, trans | cyclopentane, 1, 2, 4-trimethyl-, trans, cis- mass fractions | C (carbon) 85.6% | H (hydrogen) 14.4%](../image_source/35cec32a004c47b2760bbae2387fe766.png)
formula | C_8H_16 name | cyclopentane, 1, 2, 4-trimethyl IUPAC name | 1, 2, 4-trimethylcyclopentane alternate names | cyclopentane, 1, 2, 4-trimethyl-, cis, trans | cyclopentane, 1, 2, 4-trimethyl-, trans, cis- mass fractions | C (carbon) 85.6% | H (hydrogen) 14.4%
Lewis structure
![Draw the Lewis structure of cyclopentane, 1, 2, 4-trimethyl. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4) and hydrogen (n_H, val = 1) atoms: 8 n_C, val + 16 n_H, val = 48 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8) and hydrogen (n_H, full = 2): 8 n_C, full + 16 n_H, full = 96 Subtracting these two numbers shows that 96 - 48 = 48 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 24 bonds and hence 48 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 48 - 48 = 0 electrons left to draw and the diagram is complete: Answer: | |](../image_source/e68fc9ab0f66c031739775d50904f46d.png)
Draw the Lewis structure of cyclopentane, 1, 2, 4-trimethyl. Start by drawing the overall structure of the molecule: Count the total valence electrons of the carbon (n_C, val = 4) and hydrogen (n_H, val = 1) atoms: 8 n_C, val + 16 n_H, val = 48 Calculate the number of electrons needed to completely fill the valence shells for carbon (n_C, full = 8) and hydrogen (n_H, full = 2): 8 n_C, full + 16 n_H, full = 96 Subtracting these two numbers shows that 96 - 48 = 48 bonding electrons are needed. Each bond has two electrons, so the above diagram has all the necessary bonds. There are 24 bonds and hence 48 bonding electrons in the diagram. Lastly, fill in the remaining unbonded electrons on each atom. In total, there remain 48 - 48 = 0 electrons left to draw and the diagram is complete: Answer: | |
3D structure
![3D structure](../image_source/f563a849cfd8737ba23f5f1930d12b21.png)
3D structure
Basic properties
![molar mass | 112.22 g/mol phase | liquid (at STP) boiling point | 112.8 °C density | 0.7565 g/cm^3 solubility in water | insoluble](../image_source/a40529a9df104016f0b1269e61a4bbc0.png)
molar mass | 112.22 g/mol phase | liquid (at STP) boiling point | 112.8 °C density | 0.7565 g/cm^3 solubility in water | insoluble
Units
Liquid properties (at STP)
![density | 0.7565 g/cm^3 refractive index | 1.4156](../image_source/33bd7b0776b14c985f49ea1019e67cbb.png)
density | 0.7565 g/cm^3 refractive index | 1.4156
Units
Chemical identifiers
![CAS number | 2815-58-9 Beilstein number | 1900324 PubChem CID number | 17779 SMILES identifier | CC1CC(C(C1)C)C InChI identifier | InChI=1/C8H16/c1-6-4-7(2)8(3)5-6/h6-8H, 4-5H2, 1-3H3 EU number | 220-564-3](../image_source/660fef47aae9191eeb107456b440b4f9.png)
CAS number | 2815-58-9 Beilstein number | 1900324 PubChem CID number | 17779 SMILES identifier | CC1CC(C(C1)C)C InChI identifier | InChI=1/C8H16/c1-6-4-7(2)8(3)5-6/h6-8H, 4-5H2, 1-3H3 EU number | 220-564-3