Search

name of zinc sulfite dihydrate

Input interpretation

zinc sulfite dihydrate
zinc sulfite dihydrate

Chemical names and formulas

formula | ZnSO_3·2H_2O Hill formula | H_4O_5SZn name | zinc sulfite dihydrate mass fractions | H (hydrogen) 2.22% | O (oxygen) 44.1% | S (sulfur) 17.7% | Zn (zinc) 36%
formula | ZnSO_3·2H_2O Hill formula | H_4O_5SZn name | zinc sulfite dihydrate mass fractions | H (hydrogen) 2.22% | O (oxygen) 44.1% | S (sulfur) 17.7% | Zn (zinc) 36%

Structure diagram

Structure diagram
Structure diagram

Basic properties

molar mass | 181.5 g/mol phase | solid (at STP) melting point | 200 °C
molar mass | 181.5 g/mol phase | solid (at STP) melting point | 200 °C

Units

Chemical identifiers

CAS number | 7488-52-0 PubChem CID number | 16213628 PubChem SID number | 24872917 SMILES identifier | O.O.[O-]S(=O)[O-].[Zn+2] InChI identifier | InChI=1/H2O3S.2H2O.Zn/c1-4(2)3;;;/h(H2, 1, 2, 3);2*1H2;/q;;;+2/p-2/fO3S.2H2O.Zn/q-2;;;m MDL number | MFCD00171738
CAS number | 7488-52-0 PubChem CID number | 16213628 PubChem SID number | 24872917 SMILES identifier | O.O.[O-]S(=O)[O-].[Zn+2] InChI identifier | InChI=1/H2O3S.2H2O.Zn/c1-4(2)3;;;/h(H2, 1, 2, 3);2*1H2;/q;;;+2/p-2/fO3S.2H2O.Zn/q-2;;;m MDL number | MFCD00171738

Ion equivalents

Zn^(2+) (zinc cation) | 1 (SO_3)^(2-) (sulfite anion) | 1
Zn^(2+) (zinc cation) | 1 (SO_3)^(2-) (sulfite anion) | 1

Random Queries

alternate names of fluorocyclohexane vs 2-(trifluoromethoxy)benzonitrile
ion class of hexaiodostannate(IV) anion
common sources of ion of chromate anion vs iron(III) cation
H2SO3 + Zn(OH)2 = H2O + ZnSO3
brief symbol of Fe
nickel(II) carbonate hydroxide tetrahydrate
IUPAC name of fmoc-(4-iodo)-phe-OH vs 1-(4-iodophenyl)-5-(4-nitrophenyl)-3-phenylformazan
IUPAC name of DL-nornicotine
ion class of dicyanoaurate(I) anion vs hexaamminenickel(II) cation
CAS number of benzyl alcohol-α,α-d 2