Search

name of sodium pentafluoropropionate

Input interpretation

sodium pentafluoropropionate
sodium pentafluoropropionate

Chemical names and formulas

formula | CF_3CF_2COONa Hill formula | C_3F_5NaO_2 name | sodium pentafluoropropionate IUPAC name | sodium 2, 2, 3, 3, 3-pentafluoropropanoate alternate names | pentafluoropropionic acid sodium salt | perfluoropropionic acid sodium salt | sodium 2, 2, 3, 3, 3-pentafluoropropanoate | sodium 2, 2, 3, 3, 3-pentafluoropropionate mass fractions | C (carbon) 19.4% | F (fluorine) 51.1% | Na (sodium) 12.4% | O (oxygen) 17.2%
formula | CF_3CF_2COONa Hill formula | C_3F_5NaO_2 name | sodium pentafluoropropionate IUPAC name | sodium 2, 2, 3, 3, 3-pentafluoropropanoate alternate names | pentafluoropropionic acid sodium salt | perfluoropropionic acid sodium salt | sodium 2, 2, 3, 3, 3-pentafluoropropanoate | sodium 2, 2, 3, 3, 3-pentafluoropropionate mass fractions | C (carbon) 19.4% | F (fluorine) 51.1% | Na (sodium) 12.4% | O (oxygen) 17.2%

Structure diagram

Structure diagram
Structure diagram
vertex count | 11 edge count | 9 Schultz index | 390 Wiener index | 108 Hosoya index | 43 Balaban index | 4.404
vertex count | 11 edge count | 9 Schultz index | 390 Wiener index | 108 Hosoya index | 43 Balaban index | 4.404

Basic properties

molar mass | 186.01 g/mol phase | solid (at STP) melting point | 227.5 °C
molar mass | 186.01 g/mol phase | solid (at STP) melting point | 227.5 °C

Units

Chemical identifiers

CAS number | 378-77-8 Beilstein number | 3636648 PubChem CID number | 2733305 PubChem SID number | 24863834 SMILES identifier | C(=O)(C(C(F)(F)F)(F)F)[O-].[Na+] InChI identifier | InChI=1/C3HF5O2.Na/c4-2(5, 1(9)10)3(6, 7)8;/h(H, 9, 10);/q;+1/p-1/fC3F5O2.Na/q-1;m MDL number | MFCD00066167
CAS number | 378-77-8 Beilstein number | 3636648 PubChem CID number | 2733305 PubChem SID number | 24863834 SMILES identifier | C(=O)(C(C(F)(F)F)(F)F)[O-].[Na+] InChI identifier | InChI=1/C3HF5O2.Na/c4-2(5, 1(9)10)3(6, 7)8;/h(H, 9, 10);/q;+1/p-1/fC3F5O2.Na/q-1;m MDL number | MFCD00066167