Search

InChI identifier of thulium(III) carbonate hydrate

Input interpretation

thulium(III) carbonate hydrate | InChI identifier
thulium(III) carbonate hydrate | InChI identifier

Result

InChI=1/CH2O3.H2O.Tm/c2-1(3)4;;/h(H2, 2, 3, 4);1H2;/f/h2-3H;;
InChI=1/CH2O3.H2O.Tm/c2-1(3)4;;/h(H2, 2, 3, 4);1H2;/f/h2-3H;;

Random Queries

formula of calcium chloride vs sodium nitrite
(NH4)2SO4 = H2SO4 + NH3
discovery year of spodumene vs spodumene
Al + C = Al4C3
molar volume of thallium
formula of thallous malonate
molar mass of manganese(III) cation vs cadmium cation
full electron configuration of period 4 elements
IUPAC name of aluminum chloride vs silver nitrite
alternate names of arsenosulvanite